Name |
p-Coumaric acid p-Coumarate 4-Coumarate 4-coumaric acid |
Formula |
C9H8O3 |
Mw |
164.04734412 |
CAS RN |
7400-08-0 |
C_ID |
C00000152
,
|
InChIKey |
NGSWKAQJJWESNS-ZZXKWVIFSA-N |
InChICode |
InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3+ |
SMILES |
c1c(ccc(c1)/C=C/C(=O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | -- | Lonicera japonica | Ref. |
Plantae | Acoraceae | Acorus calamus | Ref. |
Plantae | Alliaceae | Allium obliquum | Ref. |
Plantae | Alliaceae | Allium sativum | Ref. |
Plantae | Alliaceae | Allium Sativum | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Annona muricata | Ref. |
Plantae | Annonaceae | Cananga latifolia | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Apiaceae | Falcaria vulgaris | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Aquifoliaceae | Ilex paraguariensis | Ref. |
Plantae | Aristolochiaceae | Aristolochia manshuriensis | Ref. |
Plantae | Asparagaceae | Asparagus officinalis | Ref. |
Plantae | Asphodelaceae | Aloe vera | Ref. |
Plantae | Asteraceae | Chrysanthemum boreale | Ref. |
Plantae | Asteraceae | Inula britannica | Ref. |
Plantae | Asteraceae | Matricaria chamomilla | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Balanophoraceae | Balanophora abbreviata B1 | Ref. |
Plantae | Begoniaceae | Begonia nantoensis | Ref. |
Plantae | Berberidaceae | Epimedium sagittatum | Ref. |
Plantae | Bignoniaceae | Catalpa ovata | Ref. |
Plantae | Bignoniaceae | Stereospermum zenkeri | Ref. |
Plantae | Boraginaceae | Lithospermum erythrorhizon | Ref. |
Plantae | Bromeliaceae | Ananas comosus | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Caryophyllaceae | Dianthus caryophyllus | Ref. |
Plantae | Caryophyllales | Beta vulgaris L. var. saccharifera | Ref. |
Plantae | Chenopodiaceae | Spinacia oleracea | Ref. |
Plantae | Chloranthaceae | Sarcandra glabra | Ref. |
Plantae | Commelinaceae | Commelina communis | Ref. |
Plantae | Commelinaceae | Dichorisandra thyrsiflora | Ref. |
Plantae | Convolvulaceae | Cuscuta australis | Ref. |
Plantae | Crassulaceae | Bryophyllum pinnatum | Ref. |
Plantae | Crassulaceae | Rhodiola sachalinensis | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica napus | Ref. |
Plantae | Cruciferae | Brassica oleracea var. gongylodes | Ref. |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Cucurbitaceae | Citrullus colocynthis | Ref. |
Plantae | Cucurbitaceae | Cucumis sativus | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Cyperaceae | Cyperus papyrus | Ref. |
Plantae | Cyperaceae | Cyperus rotundus L. | Ref. |
Plantae | Dioscoreaceae | Dioscorea alata | Ref. |
Plantae | Ephedraceae | Ephedra alata | Ref. |
Plantae | Ephedraceae | Ephedra equisetina | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Lens esculenta | Ref. |
Plantae | Fabaceae | Lupinus albus | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Melilotus messanensis | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Pueraria candollei var. mirifica | Ref. |
Plantae | Fabaceae | Sophora flavescens | Ref. |
Plantae | Fabaceae | Sophora japonica | Ref. |
Plantae | Fabaceae | Trifolium alpestre | Ref. |
Plantae | Fabaceae | Trifolium medium | Ref. |
Plantae | Fabaceae | Trifolium pratense L. | Ref. |
Plantae | Fumariaceae | Fumaria capreolata | Ref. |
Plantae | Fumariaceae | Fumaria officinalis | Ref. |
Plantae | Fumariaceae | Fumaria schleicheri | Ref. |
Plantae | Fumariaceae | Fumaria vaillantii | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Haemodoraceae | Anigozanthos preissii | Ref. |
Plantae | Hydrocharitaceae | Thalassia testudinum | Ref. |
Plantae | Iridaceae | Crocus sativus | Ref. |
Plantae | Juncaceae | Juncus inflexus | Ref. |
Plantae | Labiatae | Melissa officinalis | Ref. |
Plantae | Labiatae | Mentha piperitae | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Ocimum sanctum | Ref. |
Plantae | Labiatae | Origanum acutidens | Ref. |
Plantae | Labiatae | Origanum dubium | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Satureja subspicata | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Labiatae | Thymus comosus | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Liliaceae | Notholirion hyacinthium | Ref. |
Plantae | Lygodiaceae/Schizaeaceae | Lygodium japonicum | Ref. |
Plantae | Lythraceae | Lawsonia inermis | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Magnoliaceae | Magnolia denudata | Ref. |
Plantae | Magnoliaceae | Magnolia liliiflora | Ref. |
Plantae | Malvaceae | Althaea nudiflora | Ref. |
Plantae | Malvaceae | Althaea rosea | Ref. |
Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
Plantae | Malvaceae | Malva silvestris | Ref. |
Plantae | Moraceae | Morus alba | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrine | Ref. |
Plantae | Moringaceae | Moringa stenopetala | Ref. |
Plantae | Myrtaceae | Eucalyptus maculata | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
Plantae | Oleaceae | Syringa oblata | Ref. |
Plantae | Orchidaceae | Bulbophyllum vaginatum | Ref. |
Plantae | Orchidaceae | Gymnadenia conopsea R.BR. | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Palmae | Phoenix canariensis | Ref. |
Plantae | Pinaceae | Picea abies | Ref. |
Plantae | Pinaceae | Picea ajanensis | Ref. |
Plantae | Pinaceae | Picea obovata | Ref. |
Plantae | Pinaceae | Pinus radiata | Ref. |
Plantae | Pinaceae | Pinus spp. | Ref. |
Plantae | Plantaginaceae | Plantago major | Ref. |
Plantae | Plantaginaceae | Plantago media | Ref. |
Plantae | Plantaginaceae | Veronica officinalis | Ref. |
Plantae | Plantaginaceae | Veronica orchidea | Ref. |
Plantae | Plantaginaceae | Veronica spicata | Ref. |
Plantae | Plantaginaceae | Veronica teucrium | Ref. |
Plantae | Poaceae | Cymbopogon citratus | Ref. |
Plantae | Poaceae | Gynerium sagittatum | Ref. |
Plantae | Poaceae | Maize bran | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Poaceae | Panicum virgatum | Ref. |
Plantae | Poaceae | Phyllostachys edulis | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Poaceae | Zea mays | Ref. |
Plantae | Polygonaceae | Calligonum leucocladum | Ref. |
Plantae | Ranunculaceae | Actaea racemosa | Ref. |
Plantae | Ranunculaceae | Ranunculus baudotii | Ref. |
Plantae | Restionaceae | Baloskion tetraphyllum | Ref. |
Plantae | Restionaceae | Elegia capensis | Ref. |
Plantae | Rhamnaceae | Colubrina faralaotra subsp.trichocarpa. | Ref. |
Plantae | Rosaceae | Cowania mexicana | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rosaceae | Prunus serotina | Ref. |
Plantae | Rosaceae | Spiraea formosana | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus paradisi | Ref. |
Plantae | Rutaceae | Phellodendron japonicum MAXIM | Ref. |
Plantae | Salicaceae | Populus deltoides | Ref. |
Plantae | Salicaceae | Populus spp. | Ref. |
Plantae | Salicaceae | Populus trichocarpa | Ref. |
Plantae | Sarcolaenaceae | Leptolaena diospyroidea | Ref. |
Plantae | Sarcolaenaceae | Leptolaena pauciflora | Ref. |
Plantae | Scrophulariaceae | Scrophularia buergeriana | Ref. |
Plantae | Simaroubaceae | Ailanthus integrifolia | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Staphyleaceae | Euscaphis konishii | Ref. |
Plantae | Strelitziaceae | Strelitzia reginae | Ref. |
Plantae | Taxaceae | Taxus baccata | Ref. |
Plantae | Typhaceae | Typha domingensis P. | Ref. |
Plantae | Typhaceae | Typha orientalis | Ref. |
Plantae | Typhaceae/Sparganiaceae | Sparganium stoloniferum | Ref. |
Plantae | Vitaceae | Vitis rupestris | Ref. |
Plantae | Vitaceae | Vitis vinifera | Ref. |
Plantae | Zingiberaceae | Alpinia blepharocalyx | Ref. |
Plantae | Zingiberaceae | Curcuma domestica | Ref. |
Plantae | Zingiberaceae | Curcuma longa | Ref. |
Plantae | Zingiberaceae | Curcuma mangga | Ref. |
Plantae | Zingiberaceae | Hedychium gardnerianum | Ref. |
Plantae | Zygophyllaceae | Larrea divaricata | Ref. |
- | - | Caffea sp. | Ref. |
- | - | Ephedar aphylla | Ref. |
- | - | Equsetum arvense | Ref. |
- | - | FOOD SAKE | Ref. |
- | - | Sarcolaeana multiflora | Ref. |
- | - | Scrophularis sambucifolia | Ref. |
|
|
zoom in
Organism | Fumaria capreolata | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|