input type = organism , input word = Piper cubeba

Number of matched data :22
C_ID CAS ID Metabolite Molecular formula MwOrganism
C0000065940957-99-1(+)-MedioresinolC21H24O7388.15220312Piper cubeba
C0000072681861-74-7MagnosalinC24H32O6416.21988875Piper cubeba
C0000259118423-69-3(-)-CubebinC20H20O6356.12598837Piper cubeba
C0000259840456-50-6(-)-DeoxypodorhizoneC22H24O7400.15220312Piper cubeba
C0000259924563-03-9DihydrocubebinC20H22O6358.14163844Piper cubeba
C0000260826543-89-5HinokininC20H18O6354.11033831Piper cubeba
C00003035141-27-5(E)-CitralC10H16O152.12011513Piper cubeba
C00003036106-26-3(Z)-CitralC10H16O152.12011513Piper cubeba
C000030437705-14-8DipenteneC10H16136.12520051Piper cubeba
C0000312017699-14-8alpha-CubebeneC15H24204.18780077Piper cubeba
C0000312113744-15-5beta-CubebeneC15H24204.18780077Piper cubeba
C00010825470-67-71,4-CineoleC10H18O154.1357652Piper cubeba
C0002013654324-03-7BicyclosesquiphellandreneC15H24204.18780077Piper cubeba
C0002014519912-67-5EpicubenolC15H26O222.19836545Piper cubeba
C0003373421284-22-0CubenolC15H26O222.19836545Piper cubeba
C00036322113532-12-0(+)-ZeylenolC21H20O7384.12090299Piper cubeba
C0004198486992-94-1(-)-ClusinC22H26O7402.16785319Piper cubeba
C0004198596238-92-5(-)-CubebininC24H32O8448.209718Piper cubeba
C0004198673149-51-6(-)-DihydroclusinC22H28O7404.18350325Piper cubeba
C000422192883-98-9alpha-AsaroneC12H16O3208.10994438Piper cubeba
C0004249993395-17-6EthoxyclusinC24H30O7430.19915331Piper cubeba
C0005061984897-03-2(8R,8'R,9'S)-5-MethoxyclusinC23H28O8432.17841787Piper cubeba