input type = organism , input word = Matricaria chamomilla

Number of matched data :19
C_ID CAS ID Metabolite Molecular formula MwOrganism
C0000310323178-88-3(+)-alpha-BisabololC15H26O222.19836545Matricaria chamomilla
C00003114529-05-5ChamazuleneC14H16184.12520051Matricaria chamomilla
C00003138489-84-9GuaiazuleneC15H18198.14085057Matricaria chamomilla
C0000332129041-35-8MatricinC17H22O5306.14672381Matricaria chamomilla
C0000417675357-75-4Apigenin 7-(2''-acetylglucoside)C23H22O11474.11621155Matricaria chamomilla
C0000417772741-92-5Apigenin 7-(6''-acetylglucoside)C23H22O11474.11621155Matricaria chamomilla
C0000418884323-20-6Apigenin 7-(2'',3''-diacetylglucoside)C25H24O12516.12677623Matricaria chamomilla
C0000418984323-21-7Apigenin 7-(3'',4''-diacetylglucoside)C25H24O12516.12677623Matricaria chamomilla
C0000434332061-83-9Luteolin 3'-methyl ether 7-rutinosideC28H32O15608.17412036Matricaria chamomilla
C0000459332520-55-16-MethoxykaempferolC16H12O7316.05830274Matricaria chamomilla
C00004680519-96-0PatuletinC16H12O8332.05321736Matricaria chamomilla
C000046845188-73-8AxillarinC17H14O8346.06886743Matricaria chamomilla
C00004705479-91-4CasticinC19H18O8374.10016755Matricaria chamomilla
C0000564419833-25-1Patuletin 7-glucosideC22H22O13494.10604079Matricaria chamomilla
C0001160723089-26-1(-)-alpha-BisabololC15H26O222.19836545Matricaria chamomilla
C0001165122567-36-8(-)-alpha-Bisabolol oxide AC15H26O2238.19328007Matricaria chamomilla
C0001165226184-88-3(-)-alpha-Bisabolol oxide BC15H26O2238.19328007Matricaria chamomilla
C0001165359861-08-4alpha-Bisabolol oxide CC15H26O2238.19328007Matricaria chamomilla
C000208185989-43-5MatricarinC17H20O5304.13107375Matricaria chamomilla