input type = organism , input word = Brassica rapa

Number of matched data :36
C_ID CAS ID Metabolite Molecular formula MwOrganism
C0000010530536-48-2Caulilexin CC11H10N2O186.07931296Brassica rapa
C00000107771-51-7Indole-3-acetonitrileC10H8N2156.06874827Brassica rapa
C000001254356-52-9GlucobrassicinC16H20N2O9S2448.06102171Brassica rapa
C000001265187-84-8NeoglucobrassicinC17H22N2O10S2478.0715864Brassica rapa
C0000012783327-20-24-HydroxyglucobrassicinC16H20N2O10S2464.05593634Brassica rapa
C0000012883327-21-34-MethoxyglucobrassicinC17H22N2O10S2478.0715864Brassica rapa
C0000146319041-10-2GlucobrassicanapinC12H21NO9S2387.06577274Brassica rapa
C0000147326888-03-9GlucoiberverinC11H21NO9S3407.03784347Brassica rapa
C0000147719764-03-5GluconapoleiferinC12H21NO10S2403.06068736Brassica rapa
C00001486585-95-5ProgoitrinC11H19NO10S2389.0450373Brassica rapa
C00001546105748-60-5MethoxybrassininC12H14N2OS2266.05475454Brassica rapa
C00003646474-67-9BrassicasterolC28H46O398.35486609Brassica rapa L.
C00003647474-62-4CampesterolC28H48O400.37051615Brassica rapa L.
C0000522955136-76-0Kaempferol 3-O-sophoroside 7-O-beta-D-glucopyranoside:Kaempferol 3-sophoroside-7-glucosideC33H40O21772.20620834Brassica rapa
C000055566758-51-6Isorhamnetin 3,7-di-O-beta-glucopyranosideC28H32O17640.1639496Brassica rapa
C000073294837-74-5ArvelexinC11H10N2O186.07931296Brassica rapa
C0000734327303-31-7GlucoiberinC11H21NO10S3423.03275809Brassica rapa
C0000734421973-56-8GlucoerucinC12H23NO9S3421.05349353Brassica rapa
C00007345499-37-65-Methylsulfinylpentyl glucosinolateC13H25NO10S3451.06405822Brassica rapa
C00007350499-30-92-PhenylethylglucosinolateC15H21NO9S2423.06577274Brassica rapa
C0000754521414-41-5GlucoraphaninC12H23NO10S3437.04840815Brassica rapa
C0000758619041-09-9GluconapinC11H19NO9S2373.05012267Brassica rapa
C0000786419237-18-4EpiprogoitrinC11H19NO10S2389.0450373Brassica rapa
C00026588722455-60-9RutalexinC11H8N2O2S232.03064824Brassica rapa
C00026995113866-40-3S-(-)-SpirobrassininC11H10N2OS2250.02345442Brassica rapa
C00027106105748-59-2BrassininC11H12N2S2236.04418986Brassica rapa
C00027107113866-44-7Brassicanal AC10H9NOS191.04048465Brassica rapa
C00027108119752-76-0BrassilexinC9H6N2S174.02516894Brassica rapa
C00030767119-36-8Methyl salicylateC8H8O3152.04734412Brassica rapa
C0003127390-02-8SalicylaldehydeC7H6O2122.03677944Brassica rapa
C00033745105748-58-1CyclobrassininC11H10N2S2234.02853979Brassica rapa
C00034193929083-72-7Rapalexin AC10H8N2OS204.03573362Brassica rapa
C00034194929083-73-8Rapalexin BC10H8N2O2S220.03064824Brassica rapa
C00034922113900-63-31-MethoxybrassitinC12H14N2O2S250.07759844Brassica rapa
C00036583129602-03-54-MethoxybrassininC12H14N2OS2266.05475454Brassica rapa
C00036837126654-63-5Brassicanal BC12H11NO2S233.05104933Brassica rapa