input type = organism , input word = ^Platycladus

Number of matched data :11
C_ID CAS ID Metabolite Molecular formula MwOrganism
C000223214966-13-6Lambertianic acidC20H28O3316.20384476Platycladus orientalis
C000227081909-91-7(+)-Isocupressic acidC20H32O3320.23514489Platycladus orientalis
C0002272239702-14-213-Epicupressic acidC20H32O3320.23514489Platycladus orientalis
C0002277040433-82-7Pinusolidic acidC20H28O4332.19875938Platycladus orientalis
C0002277131685-80-0PinusolideC21H30O4346.21440945Platycladus orientalis
C00031283471-74-9Sandaracopimaric acidC20H30O2302.2245802Platycladus orientalis
C000323653772-56-3TotaradiolC20H30O2302.2245802Platycladus orientalis
C00032600287733-44-214,15,-Bisnor-8(17)-labdene-16,19-dioic acidC18H28O4308.19875938Platycladus orientalis
C00032668287733-45-36,7-Dehydrosandaracopimaric acidC20H28O2300.20893014Platycladus orientalis
C000335273650-30-413-EpitorulosolC20H34O2306.25588033Platycladus orientalis
C00033539162555-66-01-Oxo-3beta-HydroxytotarolC20H28O3316.20384476Platycladus orientalis