input type = metabolite , input word = linalool

Number of matched data :23
C_ID CAS ID Metabolite Molecular formula Mw
C0000304778-70-6(+-)-Linalool
linalool
Linalool
beta-Linalool
(R)-linalool
(R)-(-)-3,7-Dimethyl-1,6-octadien-3-ol
C10H18O154.1357652
C00010301126-90-9(+)-S-Linalool
S-(+)-Linalool
(S)-Linalool
Coriandrol
(S)-3,7-Dimethyl-1,6-octadien-3-ol
C10H18O154.1357652
C0001030282928-12-9Linalool glucoside
Linaloyl beta-D-glucopyranoside
C16H28O6316.18858863
C0001032514049-11-7Epoxylinalool
Linalool oxide
3-Hydroxy-2,2,6-trimethyl-6-vinyltetrahydropyran
C10H18O2170.13067982
C0002206877129-36-312-OxogeranyllinaloolC20H32O2304.24023027
C000221091113-21-9Geranyl linalool
Geranyllinalool
(E,E)-Geranyllinalool
geranyllinalool
C20H34O290.26096571
C00034358108943-16-4(S)-8-OxolinaloolC10H16O2168.11502975
C0003449634995-77-2trans-Furanoid linalool oxide
trans-Linalool oxide
E-Furanoid linalool oxide
C10H18O2170.13067982
C000347465989-33-3Z-Furanoid linalool oxideC10H18O2170.13067982
C0003474714009-71-3cis-Linalool oxide pyranoid
Z-Pyranoid linalool oxide
C10H18O2170.13067982
C000348186537-80-0Cichoric acid
cis-Linalool oxide
C22H18O12474.07982604
C00034888126-91-0(-)-linalool
(-)-R-Linalool
-(-)-Linalool
C10H18O154.1357652
C00035042598-07-2alpha-LinaloolC10H18O154.1357652
C00036128792933-02-9IsovaleroyloxylinaloolC15H26O3254.1881947
C00036606288152-87-46,7-Dihydroxydihydrolinalool 3-O-beta-glucopyranoside
(-)-6,7-Dihydroxydihydrolinalool 3-O-beta-glucopyranoside
C16H30O8350.19406794
C00036607288152-88-56,7-Dihydroxydihydrolinalool 7-O-beta-glucopyranoside
(-)-6,7-Dihydroxydihydrolinalool 7-O-beta-glucopyranoside
C16H30O8350.19406794
C0005247529171-20-8(+-)-Dehydrolinalool
Dehydrolinalool
C10H16O152.12011513
C0005250464142-78-58-Hydroxylinalool
(7Z)-8-Hydroxylinalool
C10H18O2170.13067982
C0005312973413-94-2cis-Dehydroxylinalool oxideC10H18O154.1357652
C0005382878-69-3TetrahydrolinaloolC10H22O158.16706532
C0005876139028-58-5trans-Linalool 3,7-oxide
trans-(-)-Linalool oxide pyranoid
C10H18O2170.13067982
C0006007515249-34-0Linalool-1,2-epoxideC10H18O2170.13067982
C0006094223007-29-6(+)-Linaloolfuran oxide BC10H18O2170.13067982