input type = metabolite , input word = higenamine

Number of matched data :4
C_ID CAS ID Metabolite Molecular formula Mw
C0003461322672-77-1(S)-Norcoclaurine
Norcoclaurine
(S)-(-)-Higenamine
C16H17NO3271.12084342
C0004955466277-20-1N-MethylhigenamineC17H19NO3285.13649348
C00049555240430-84-6(-)-N-Methylhigenamine N-oxideC17H19NO4301.1314081
C000495565843-65-2HigenamineC16H17NO3271.12084342