input type = metabolite , input word = coclaurine

Number of matched data :14
C_ID CAS ID Metabolite Molecular formula Mw
C00001846106032-53-5(+)-DemethylcoclaurineC16H17NO3271.12084342
C000252683423-07-2(+)-N-Methylcoclaurine
(+)-(S)-N-Methylcoclaurine
N-Methylcoclaurine
C18H21NO3299.15214354
C000256195096-70-8(-)-N-Methylcoclaurine
(R)-N-Methylcoclaurine
C18H21NO3299.15214354
C000256522196-60-3(+)-Coclaurine
(+)-R-Coclaurine
(R)-Coclaurine
Sanjoinine K
d-Coclaurine
C17H19NO3285.13649348
C00025812486-39-5Coclaurine
(S)-Coclaurine
(-)-Coclaurine
C17H19NO3285.13649348
C00027385574-75-4Isococlaurine
R-(+)-Isococlaurine
C17H19NO3285.13649348
C0003461322672-77-1(S)-Norcoclaurine
Norcoclaurine
(S)-(-)-Higenamine
C16H17NO3271.12084342
C00034979154727-04-54'-O-Methylcoclaurine
(-)-4'-O-Methylcoclaurine
C18H21NO3299.15214354
C000478502033-08-1dl-CoclaurineC17H19NO3285.13649348
C00051846(S)-3'-Hydroxy-N-methylcoclaurineC18H21NO4315.14705817
C000519773'-Hydroxy-7-O-methylcoclaurineC18H21NO4315.14705817
C000519897-O-MethylcoclaurineC18H21NO3299.15214354
C000519917,4'-Di-O-MethylcoclaurineC19H23NO3313.16779361
C000599981472-62-4(RS)-N-MethylcoclaurineC18H21NO3299.15214354