input type = all , input word = C00011022

Number of matched data :1
C_ID CAS ID Metabolite Molecular formula MwOrganism or InChIKey etc.
C0001102210334-13-1(-)-Isoborneol
L-Isoborneol
(-)-Isoborneol
C10H18O154.1357652Zingiber officinale