Name |
cis-3-Hexenyl acetate (Z)-3-Hexenyl acetate |
Formula |
C8H14O2 |
Mw |
142.09937969 |
CAS RN |
3681-71-8 |
C_ID |
C00048964
,
|
InChIKey |
NPFVOOAXDOBMCE-PLNGDYQASA-N |
InChICode |
InChI=1S/C8H14O2/c1-3-4-5-6-7-10-8(2)9/h4-5H,3,6-7H2,1-2H3/b5-4- |
SMILES |
C(C/C=C\CC)OC(=O)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Anacardium occidentale | Ref. |
Plantae | Asteraceae | Matricaria recutita | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Caryophyllaceae | Silene latifolia | Ref. |
Plantae | Caryophyllales | Beta vulgaris | Ref. |
Plantae | Cruciferae | Brassica rapa | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Oleaceae | Olea europaea | Ref. |
Plantae | Orchidaceae | Epipactis helleborine | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Rutaceae | Murraya paniculata | Ref. |
Plantae | Scrophulariaceae | Scrophularia umbrosa | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Taxaceae | Taxus wallichiana | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
|
|
zoom in
Organism | Taxus wallichiana | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|