Name |
3-Methyl-butanal Isovaleraldehyde 3-Methylbutanal 3-methylbutanal |
Formula |
C5H10O |
Mw |
86.07316494 |
CAS RN |
590-86-3 |
C_ID |
C00048949
,
|
InChIKey |
YGHRJJRRZDOVPD-UHFFFAOYSA-N |
InChICode |
InChI=1S/C5H10O/c1-5(2)3-4-6/h4-5H,3H2,1-2H3 |
SMILES |
CC(C)CC=O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Exhaled breath) | Ref. |
Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Ceratophyllaceae | Ceratophyllum demersum | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris | Ref. |
Plantae | Cucurbitaceae | Citrullus vulgaris | Ref. |
Plantae | Fabaceae | Sophora japonica | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Oleaceae | Olea europaea | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rubiaceae | Coffea arabica | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
- | - | Caffea sp. | Ref. |
- | - | FOOD SAKE | Ref. |
- | - | Tuber borchii | Ref. |
- | - | Tuber brumale | Ref. |
- | - | Tuber excavatum | Ref. |
- | - | Tuber indicum | Ref. |
- | - | Tuber magnatum | Ref. |
- | - | Tuber melanosporum | Ref. |
- | - | Tuber mesentericum | Ref. |
- | - | Tuber oligospermum | Ref. |
- | - | Tuber panniferum | Ref. |
- | - | Tuber rufum | Ref. |
- | - | Tuber uncinatum | Ref. |
|
|
zoom in
Organism | Zingiber officinale | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
---|
|