Name |
Isoborneol |
Formula |
C10H18O |
Mw |
154.1357652 |
CAS RN |
124-76-5 |
C_ID |
C00048432
,
|
InChIKey |
DTGKSKDOIYIVQL-AFAAIUEZNA-N |
InChICode |
InChI=1S/C10H18O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7-8,11H,4-6H2,1-3H3/t7-,8-,10+/m1/s1 |
SMILES |
[C@H]1(C[C@H]2CC[C@@]1(C2(C)C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Strobilanthes auriculatus | Ref. |
Plantae | Apiaceae | Falcaria vulgaris | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Thymus broussonetti | Ref. |
Plantae | Labiatae | Thymus maroccanus | Ref. |
Plantae | Labiatae | Thymus praecos | Ref. |
Plantae | Labiatae | Thymus pubescens | Ref. |
Plantae | Lauraceae | Cinnamomum camphora | Ref. |
Plantae | Pinaceae | Pinus mugo subsp. Mugo | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Rosaceae | Prunus salcina Lindl. (Blackamber) | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis | Ref. |
Plantae | Zingiberaceae | Curcuma aeruginosa | Ref. |
Plantae | Zingiberaceae | Curcuma amada | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Curcuma aromatica | Ref. |
Plantae | Zingiberaceae | Curcuma kwangsiensis | Ref. |
Plantae | Zingiberaceae | Curcuma longa | Ref. |
Plantae | Zingiberaceae | Curcuma mangga | Ref. |
Plantae | Zingiberaceae | Curcuma phaeocaulis | Ref. |
Plantae | Zingiberaceae | Curcuma wenyujin | Ref. |
Plantae | Zingiberaceae | Curcuma xanthorrhiza | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
|
|
zoom in
Organism | Thymus maroccanus | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|