Name |
Isobergapten |
Formula |
C12H8O4 |
Mw |
216.04225874 |
CAS RN |
482-48-4 |
C_ID |
C00037321
,
|
InChIKey |
AJSPSRWWZBBIOR-UHFFFAOYSA-N |
InChICode |
InChI=1S/C12H8O4/c1-14-9-6-10-8(4-5-15-10)12-7(9)2-3-11(13)16-12/h2-6H,1H3 |
SMILES |
COc1cc2occc2c2oc(=O)ccc12 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Angelica pubescens f.biserrata | Ref. |
Plantae | Apiaceae | Heracleum asperum | Ref. |
Plantae | Apiaceae | Heracleum canescens | Ref. |
Plantae | Apiaceae | Heracleum dissectum | Ref. |
Plantae | Apiaceae | Heracleum granatense | Ref. |
Plantae | Apiaceae | Heracleum grandiflorum | Ref. |
Plantae | Apiaceae | Heracleum lehmannianum | Ref. |
Plantae | Apiaceae | Heracleum moellendorffii Hance | Ref. |
Plantae | Apiaceae | Heracleum moellendorffii Hance var.paucivitatum | Ref. |
Plantae | Apiaceae | Heracleum nepalense | Ref. |
Plantae | Apiaceae | Heracleum pinnatum | Ref. |
Plantae | Apiaceae | Heracleum ponticum | Ref. |
Plantae | Apiaceae | Heracleum sphondylium | Ref. |
Plantae | Apiaceae | Heracleum wallichii | Ref. |
Plantae | Apiaceae | Heracleum woroschiklowii | Ref. |
Plantae | Apiaceae | Heracleum yungningense | Ref. |
Plantae | Apiaceae | Pimpinella magna | Ref. |
Plantae | Apiaceae | Pimpinella saxifraga | Ref. |
Plantae | Apiaceae | Tordylium apulum | Ref. |
Plantae | Moraceae | Dorstenia asaroides | Ref. |
Plantae | Moraceae | Dorstenia bahiensis | Ref. |
Plantae | Moraceae | Dorstenia barnimiana | Ref. |
Plantae | Moraceae | Dorstenia brasiliensis | Ref. |
Plantae | Moraceae | Dorstenia bryonifolia | Ref. |
Plantae | Moraceae | Dorstenia cayapiaa | Ref. |
Plantae | Moraceae | Dorstenia contrajerva | Ref. |
Plantae | Moraceae | Dorstenia drakena | Ref. |
Plantae | Moraceae | Dorstenia excentria | Ref. |
Plantae | Moraceae | Dorstenia heringerii | Ref. |
Plantae | Moraceae | Dorstenia lindeniana | Ref. |
Plantae | Moraceae | Dorstenia psilurus | Ref. |
Plantae | Rutaceae | Ruta pinnata | Ref. |
Plantae | Thymelaeaceae | Stellera chamaejasme | Ref. |
|
|
zoom in
Organism | Angelica pubescens f.biserrata | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Rao, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 18, (1993), 681.
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
---|
|