Name |
Dihydrocarvone (E)-Dihydrocarvone |
Formula |
C10H16O |
Mw |
152.12011513 |
CAS RN |
5948-04-9 |
C_ID |
C00037051
, 
|
InChIKey |
AZOCECCLWFDTAP-MDWBIBFBNA-N |
InChICode |
InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-9H,1,4-6H2,2-3H3/t8-,9-/m1/s1 |
SMILES |
C1(=O)[C@@H](CC[C@H](C1)C(=C)C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Mangifera indica  | Ref. |
Plantae | Apiaceae | Apium graveolens  | Ref. |
Plantae | Fabaceae | Trifolium pratense  | Ref. |
Plantae | Labiatae | Mentha sauveolens | Ref. |
Plantae | Labiatae | Thymus broussonetti | Ref. |
Plantae | Labiatae | Thymus capitatus  | Ref. |
Plantae | Labiatae | Thymus maroccanus | Ref. |
Plantae | Labiatae | Thymus praecos | Ref. |
Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
Plantae | Ranunculaceae | Nigella sativa L  | Ref. |
Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
|
|
zoom in
Organism | Thymus praecos | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|