Name |
3-Octanol Octan-3-ol |
Formula |
C8H18O |
Mw |
130.1357652 |
CAS RN |
589-98-0 |
C_ID |
C00035495
,
|
InChIKey |
NMRPBPVERJPACX-UHFFFAOYNA-N |
InChICode |
InChI=1S/C8H18O/c1-3-5-6-7-8(9)4-2/h8-9H,3-7H2,1-2H3/t8-/m0/s1 |
SMILES |
CCCCCC(O)CC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Fungi | Boletaceae | Boletus edulis | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Sophora japonica | Ref. |
Plantae | Labiatae | Agastache rugosus | Ref. |
Plantae | Labiatae | Clinopodium nepeta | Ref. |
Plantae | Labiatae | Mentha arvensis L. | Ref. |
Plantae | Labiatae | Mentha spp | Ref. |
Plantae | Labiatae | Mentha spp. | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Schizonepeta temuifolia | Ref. |
Plantae | Lamiaceae | Calamintha nepeta | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Plantaginaceae | Plantago lanceolata | Ref. |
Plantae | Poaceae | Capillipedium parviflorum | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
|
|
zoom in
Organism | Schizonepeta temuifolia | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
---|
|