Name |
alpha-terpineol acetate Terpinyl acetate alpha-Terpinyl acetate |
Formula |
C12H20O2 |
Mw |
196.14632988 |
CAS RN |
80-26-2 |
C_ID |
C00035043
,
|
InChIKey |
IGODOXYLBBXFDW-UHFFFAOYNA-N |
InChICode |
InChI=1S/C12H20O2/c1-9-5-7-11(8-6-9)12(3,4)14-10(2)13/h5,11H,6-8H2,1-4H3/t11-/m0/s1 |
SMILES |
CC(=O)OC(C)(C)C1CC=C(C)CC1 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Xylopia parviflora | Ref. |
Plantae | Apiaceae | Ligusticum jeholense | Ref. |
Plantae | Canellaceae | Canella winterana | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis | Ref. |
Plantae | Fabaceae | Tipuana tipu | Ref. |
Plantae | Fabaceae | Trifolium repens L. | Ref. |
Plantae | Illiciaceae | Illicium anisatum | Ref. |
Plantae | Labiatae | Clinopodium nepeta | Ref. |
Plantae | Lamiaceae | Calamintha nepeta | Ref. |
Plantae | Lauraceae | Cinnamomum camphora | Ref. |
Plantae | Lauraceae | Laurus nobilis | Ref. |
Plantae | Myrtaceae | Eucalyptus gunnii | Ref. |
Plantae | Myrtaceae | Eucalyptus resinifera | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendra L. | Ref. |
Plantae | Myrtaceae | Myrtus communis | Ref. |
Plantae | Pinaceae | Pinus mugo subsp. Mugo | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Piperaceae | Piper nigrum | Ref. |
Plantae | Plantaginaceae | Veronica spicata | Ref. |
Plantae | Rutaceae | Citrus aurantium | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Saxifragaceae | Saxifraga stolonifera | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis | Ref. |
Plantae | Zingiberaceae | Curcuma amada | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
|
|
zoom in
Organism | Veronica spicata | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|