Name |
Valencene |
Formula |
C15H24 |
Mw |
204.18780077 |
CAS RN |
4630-07-3 |
C_ID |
C00034741
,
|
InChIKey |
QEBNYNLSCGVZOH-ZECJTJDJNA-N |
InChICode |
InChI=1S/C15H24/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h7,12-13H,1,5-6,8-10H2,2-4H3/t12-,13-,15+/m1/s1 |
SMILES |
C1CC=C2[C@]([C@@H]1C)(C[C@@H](CC2)C(=C)C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Cyperaceae | Cyperus rotundus | Ref. |
Plantae | Gymnomitriaceae | Marsupella emarginata | Ref. |
Plantae | Jubulaceae | Frullania pycnantha | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Labiatae | Pogostemon cablin | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Satureja subspicata | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Polygonaceae | Polygonum minus | Ref. |
Plantae | Porellaceae | Porella acutifolia ssp.tosana | Ref. |
Plantae | Primulaceae | Primula halleri | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus sinensis L. | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Valerianaceae | Nardostachys jatamansi | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
|
|
zoom in
Organism | Zingiber officinale | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|