Name |
Uvaol Uvalol 3beta,28-Dihydroxyurs-12-ene Urs-12-ene-3beta,28-diol |
Formula |
C30H50O2 |
Mw |
442.38108084 |
CAS RN |
545-46-0 |
C_ID |
C00032467
, 
|
InChIKey |
XUARCIYIVXVTAE-FFNLIELZNA-N |
InChICode |
InChI=1S/C30H50O2/c1-19-10-15-30(18-31)17-16-28(6)21(25(30)20(19)2)8-9-23-27(5)13-12-24(32)26(3,4)22(27)11-14-29(23,28)7/h8,19-20,22-25,31-32H,9-18H2,1-7H3/t19-,20+,22+,23-,24+,25+,27+,28-,29-,30-/m1/s1 |
SMILES |
C1[C@@H](C([C@H]2[C@](C1)([C@@H]1[C@@](CC2)([C@]2(C(=CC1)[C@H]1[C@@](CC2)(CC[C@H]([C@@H]1C)C)CO)C)C)C)(C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apocynaceae | Nerium oleander  | Ref. |
Plantae | Aquifoliaceae | Ilex latifolia  | Ref. |
Plantae | Celastraceae | Microtropis fokienensis | Ref. |
Plantae | Combretaceae | Terminalia brasiliensis | Ref. |
Plantae | Ebenaceae | Diospyros kaki  | Ref. |
Plantae | Ebenaceae | Diospyros lotus  | Ref. |
Plantae | Ebenaceae | Diospyros maingayi | Ref. |
Plantae | Euphorbiaceae | Euphorbia micractina | Ref. |
Plantae | Euphorbiaceae | Euphorbia paralias | Ref. |
Plantae | Labiatae | Ocimum basilicum  | Ref. |
Plantae | Labiatae | Origanum pampaninii | Ref. |
Plantae | Myrtaceae | Syzygium formosanum | Ref. |
Plantae | Oleaceae | Olea europaea  | Ref. |
Plantae | Oleaceae | Osmanthus fragrans  | Ref. |
Plantae | Rosaceae | Prunus avium  | Ref. |
Plantae | Rosaceae | Prunus serotina  | Ref. |
Plantae | Stilbaceae | Nuxia sphaerocephala  | Ref. |
- | - | Hex aquifolium | Ref. |
- | - | Vladimiria muliensis | Ref. |
|
|
zoom in
Organism | Terminalia brasiliensis | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|