Name |
2-Undecanone Undecan-2-one Methyl nonyl ketone |
Formula |
C11H22O |
Mw |
170.16706532 |
CAS RN |
112-12-9 |
C_ID |
C00030758
,
|
InChIKey |
KYWIYKKSMDLRDC-UHFFFAOYSA-N |
InChICode |
InChI=1S/C11H22O/c1-3-4-5-6-7-8-9-10-11(2)12/h3-10H2,1-2H3 |
SMILES |
CCCCCCCCCC(C)=O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Fungi | Ganodermataceae | Ganoderma lucidum | Ref. |
Plantae | Acanthaceae | Strobilanthes crispus | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Asteraceae | Helianthus annuus | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris | Ref. |
Plantae | Jubulaceae | Frullania solanderiana | Ref. |
Plantae | Lauraceae | Cinnamomum camphora | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Pinaceae | Pinus mugo subsp. Mugo | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Piperaceae | Piper fimbriulatum | Ref. |
Plantae | Poaceae | Cymbopogon citratus | Ref. |
Plantae | Primulaceae | Primula halleri | Ref. |
Plantae | Rutaceae | Ruta graveolens | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
Plantae | Saururaceae | Houttuynia cordata Thunb. | Ref. |
Plantae | Saururaceae | Houttuynia emeiensis | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Zingiberaceae | Curcuma amada | Ref. |
Plantae | Zingiberaceae | Curcuma longa | Ref. |
Plantae | Zingiberaceae | Curcuma mangga | Ref. |
Plantae | Zingiberaceae | Curcuma phaeocaulis | Ref. |
Plantae | Zingiberaceae | Curcuma zedoaria | Ref. |
Plantae | Zingiberaceae | Zingiber officinale ROSC. | Ref. |
- | - | Spongiporus leucomallellus (Murril) | Ref. |
|
|
zoom in
Organism | Strobilanthes crispus | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|