Name |
Hederagenin |
Formula |
C30H48O4 |
Mw |
472.35526002 |
CAS RN |
465-99-6 |
C_ID |
C00030459
,
|
InChIKey |
PGOYMURMZNDHNS-VHARFRNGNA-N |
InChICode |
InChI=1S/C30H48O4/c1-25(2)13-15-30(24(33)34)16-14-28(5)19(20(30)17-25)7-8-22-26(3)11-10-23(32)27(4,18-31)21(26)9-12-29(22,28)6/h7,20-23,31-32H,8-18H2,1-6H3,(H,33,34)/t20-,21+,22+,23-,26-,27-,28+,29+,30-/m0/s1 |
SMILES |
C1[C@@H]([C@@]([C@H]2[C@](C1)([C@@H]1[C@@](CC2)([C@]2(C(=CC1)[C@H]1[C@@](CC2)(CCC(C1)(C)C)C(=O)O)C)C)C)(C)CO)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Caryophyllales | Beta vulgaris | Ref. |
Plantae | Dipsacaceae | Cephalaria transsylvanica | Ref. |
Plantae | Fabaceae | Medicago arabica | Ref. |
Plantae | Fabaceae | Medicago arborea | Ref. |
Plantae | Fabaceae | Medicago hybrida | Ref. |
Plantae | Fabaceae | Medicago polymorpha | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Labiatae | Anisomeles indica | Ref. |
Plantae | Lardizabalaceae | Stauntonia hexahylla | Ref. |
Plantae | Meliaceae | Swietenia mahogani | Ref. |
Plantae | Myrtaceae | Eugenia sandwicensis | Ref. |
Plantae | Putranjivaceae | Drypetes molunduana Pax and Hoffm | Ref. |
Plantae | Rubiaceae | Morinda citrifolia L. | Ref. |
Plantae | Sapindaceae | Blighia sapida Koenig | Ref. |
Plantae | Sapindaceae | Sapindus mukorossi | Ref. |
- | - | Ficaria verna Hudson | Ref. |
|
|
zoom in
Organism | Medicago polymorpha | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|