Name |
beta-Ionone (E)-beta-Ionone beta-lonone trans-beta-ionone |
Formula |
C13H20O |
Mw |
192.15141526 |
CAS RN |
79-77-6 |
C_ID |
C00029816
,
|
InChIKey |
PSQYTAPXSHCGMF-BQYQJAHWSA-N |
InChICode |
InChI=1S/C13H20O/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h7-8H,5-6,9H2,1-4H3/b8-7+ |
SMILES |
C1CC(=C(C(C1)(C)C)/C=C/C(=O)C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Chromalveolata | Alariaceae | Undaria pinnatifida | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Asteraceae | Centaurea sessilis | Ref. |
Plantae | Asteraceae | Dittrichia graveolens | Ref. |
Plantae | Asteraceae | Phagnalon sordidum | Ref. |
Plantae | Asteraceae | Saussurea lappa | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Caryophyllaceae | Stellaria pallida | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris | Ref. |
Plantae | Fabaceae | Tipuana tipu | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Laminariaceae | Laminaria japonica | Ref. |
Plantae | Lythraceae | Lawsonia alba | Ref. |
Plantae | Oleaceae | Osmanthus fragrans | Ref. |
Plantae | Plantaginaceae | Veronica spicata | Ref. |
Plantae | Rosaceae | Prunus armeniaca | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rosaceae | Prunus salcina Lindl. (Blackamber,Friar) | Ref. |
Plantae | Rubiaceae | Coffea arabica | Ref. |
Plantae | Rubiaceae | Coffea canephora | Ref. |
Plantae | Rutaceae | Boronia megastigma | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Lycium chinense | Ref. |
Plantae | Solanaceae | Mandragora autumnalis | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Valerianaceae | Nardostachys chinensis | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis | Ref. |
- | - | Caffea sp. | Ref. |
- | - | Microcystis aeruginosa | Ref. |
- | - | Pandanous amryllifolius | Ref. |
|
|
zoom in
Organism | Trifolium pratense | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|