Name |
beta-Ionone (E)-beta-Ionone beta-lonone trans-beta-ionone |
Formula |
C13H20O |
Mw |
192.15141526 |
CAS RN |
79-77-6 |
C_ID |
C00029816
, 
|
InChIKey |
PSQYTAPXSHCGMF-BQYQJAHWSA-N |
InChICode |
InChI=1S/C13H20O/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h7-8H,5-6,9H2,1-4H3/b8-7+ |
SMILES |
C1CC(=C(C(C1)(C)C)/C=C/C(=O)C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Chromalveolata | Alariaceae | Undaria pinnatifida  | Ref. |
Plantae | Asteraceae | Centaurea sessilis | Ref. |
Plantae | Asteraceae | Dittrichia graveolens  | Ref. |
Plantae | Asteraceae | Phagnalon sordidum | Ref. |
Plantae | Asteraceae | Saussurea lappa  | Ref. |
Plantae | Caryophyllaceae | Stellaria pallida | Ref. |
Plantae | Fabaceae | Tipuana tipu | Ref. |
Plantae | Fabaceae | Trifolium pratense  | Ref. |
Plantae | Laminariaceae | Laminaria japonica  | Ref. |
Plantae | Lythraceae | Lawsonia alba  | Ref. |
Plantae | Oleaceae | Osmanthus fragrans  | Ref. |
Plantae | Plantaginaceae | Veronica spicata | Ref. |
Plantae | Rosaceae | Prunus armeniaca  | Ref. |
Plantae | Rosaceae | Prunus salcina Lindl. (Blackamber,Friar) | Ref. |
Plantae | Rubiaceae | Coffea arabica  | Ref. |
Plantae | Rubiaceae | Coffea canephora  | Ref. |
Plantae | Rutaceae | Boronia megastigma | Ref. |
Plantae | Solanaceae | Lycium chinense  | Ref. |
Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
Plantae | Valerianaceae | Nardostachys chinensis  | Ref. |
- | - | Microcystis aeruginosa | Ref. |
- | - | Pandanous amryllifolius | Ref. |
|
|
zoom in
Organism | Veronica spicata | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|