Name |
Acetylursolic acid Ursolic acid Ursolic acid acetate |
Formula |
C32H50O4 |
Mw |
498.37091008 |
CAS RN |
7372-30-7 |
C_ID |
C00029633
,
|
InChIKey |
PHFUCJXOLZAQNH-GTFLZTGMNA-N |
InChICode |
InChI=1S/C32H50O4/c1-19-11-16-32(27(34)35)18-17-30(7)22(26(32)20(19)2)9-10-24-29(6)14-13-25(36-21(3)33)28(4,5)23(29)12-15-31(24,30)8/h9,19-20,23-26H,10-18H2,1-8H3,(H,34,35)/t19-,20+,23+,24-,25+,26+,29+,30-,31-,32+/m1/s1 |
SMILES |
C1[C@@H](C([C@H]2[C@](C1)([C@@H]1[C@@](CC2)([C@]2(C(=CC1)[C@H]1[C@@](CC2)(CC[C@H]([C@@H]1C)C)C(=O)O)C)C)C)(C)C)OC(=O)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Adoxaceae | Viburnum lantana L. | Ref. |
Plantae | Amaranthaceae | Achyranthes aspera | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Apiaceae | Heracleum granatense | Ref. |
Plantae | Apocynaceae | Catharanthus roseus | Ref. |
Plantae | Apocynaceae | Nerium oleander | Ref. |
Plantae | Apocynaceae | Plumeria obtusa | Ref. |
Plantae | Aquifoliaceae | Ilex asprella | Ref. |
Plantae | Aquifoliaceae | Ilex cornuta | Ref. |
Plantae | Aquifoliaceae | Ilex integra | Ref. |
Plantae | Aquifoliaceae | Ilex pubescens | Ref. |
Plantae | Araliaceae | Acanthopanax senticosus | Ref. |
Plantae | Araliaceae | Acanthopanax sessiliflorus | Ref. |
Plantae | Araliaceae | Centella asiatica | Ref. |
Plantae | Araliaceae | Cussonia bancoensis | Ref. |
Plantae | Asteraceae | Achyrocline bogotensis (HBK.) DC. | Ref. |
Plantae | Asteraceae | Ligularia sagitta | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum polyanthum | Ref. |
Plantae | Cecropiaceae | Myrianthus arboreus | Ref. |
Plantae | Celastraceae | Microtropis japonica | Ref. |
Plantae | Combretaceae | Terminalia fagifolia | Ref. |
Plantae | Convallariaceae | Liriope muscari | Ref. |
Plantae | Cornaceae | Camptotheca acuminata | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus kousa | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis | Ref. |
Plantae | Cruciferae | Isatis tinctoria | Ref. |
Plantae | Cynomoriaceae | Cynomorium songaricum | Ref. |
Plantae | Dipterocarpaceae | Vatica cinerea | Ref. |
Plantae | Ebenaceae | Diospyros castanea | Ref. |
Plantae | Ebenaceae | Diospyros cauliflora | Ref. |
Plantae | Ebenaceae | Diospyros curranii | Ref. |
Plantae | Ebenaceae | Diospyros ebenum | Ref. |
Plantae | Ebenaceae | Diospyros evena | Ref. |
Plantae | Ebenaceae | Diospyros ferrea | Ref. |
Plantae | Ebenaceae | Diospyros hirsuta | Ref. |
Plantae | Ebenaceae | Diospyros kaki | Ref. |
Plantae | Ebenaceae | Diospyros leucomelas | Ref. |
Plantae | Ebenaceae | Diospyros lotus | Ref. |
Plantae | Ebenaceae | Diospyros malanonilau | Ref. |
Plantae | Ebenaceae | Diospyros melanoxylon | Ref. |
Plantae | Ebenaceae | Diospyros montana | Ref. |
Plantae | Ebenaceae | Diospyros morrisiana | Ref. |
Plantae | Ebenaceae | Diospyros quaesita | Ref. |
Plantae | Ebenaceae | Diospyros tomentosa | Ref. |
Plantae | Ericaceae | Arbutus andrachne L. | Ref. |
Plantae | Ericaceae | Enkianthus cernuus | Ref. |
Plantae | Ericaceae | Epigaea asiatica | Ref. |
Plantae | Ericaceae | Leucothoe grayana Max. | Ref. |
Plantae | Ericaceae | Pieris japonica D.Don. | Ref. |
Plantae | Ericaceae | Pyrola incarnata | Ref. |
Plantae | Ericaceae | Pyrola japonica | Ref. |
Plantae | Ericaceae | Pyrola rugosa | Ref. |
Plantae | Ericaceae | Rhododendron hymenanthus | Ref. |
Plantae | Eucommiaceae | Eucommia ulmoides | Ref. |
Plantae | Euphorbiaceae | Euphorbia paralias | Ref. |
Plantae | Fabaceae | Indigofera tetrantha | Ref. |
Plantae | Gentianaceae | Gentianopsis paludosa | Ref. |
Plantae | Hydrangeaceae | Hydrangea heteromalla | Ref. |
Plantae | Icacinaceae | Gonocaryum calleryanum | Ref. |
Plantae | Juglandaceae | Platycarya strobilacea | Ref. |
Plantae | Labiatae | Callicarpa arborea | Ref. |
Plantae | Labiatae | Callicarpa formosana | Ref. |
Plantae | Labiatae | Callicarpa macrophylla | Ref. |
Plantae | Labiatae | Dracocephalum kotschyi | Ref. |
Plantae | Labiatae | Glechoma lungituba | Ref. |
Plantae | Labiatae | Hyptis brevipes | Ref. |
Plantae | Labiatae | Isodon oresbia | Ref. |
Plantae | Labiatae | Isodon ternifolius | Ref. |
Plantae | Labiatae | Lavandula canariensis | Ref. |
Plantae | Labiatae | Lavandula gibsonii | Ref. |
Plantae | Labiatae | Meriandra benghalensis | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Origanum dubium | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Orthosiphon stamineus | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Labiatae | Prostanthera melissifolia | Ref. |
Plantae | Labiatae | Prunella vulgaris | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia breviflora | Ref. |
Plantae | Labiatae | Salvia canariensis L. | Ref. |
Plantae | Labiatae | Salvia chinopeplica | Ref. |
Plantae | Labiatae | Salvia miltiorrhiza | Ref. |
Plantae | Labiatae | Salvia nicolsoniana | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Salvia virgata | Ref. |
Plantae | Labiatae | Satureja acinos | Ref. |
Plantae | Labiatae | Satureja calamintha | Ref. |
Plantae | Labiatae | Sideritis candicans var.eriocephala | Ref. |
Plantae | Labiatae | Sideritis discolor | Ref. |
Plantae | Labiatae | Sideritis soluta | Ref. |
Plantae | Labiatae | Thymus pubescens | Ref. |
Plantae | Lamiaceae | Coleus aromaticus | Ref. |
Plantae | Lamiaceae | Rabdosia rubescens | Ref. |
Plantae | Longaniaceae | Strychnos vanprukii Craib. | Ref. |
Plantae | Lythraceae | Lawsonia inermis | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malpighiaceae | Acridocarpus vivy | Ref. |
Plantae | Melastomataceae | Monochaetum vulcanicum | Ref. |
Plantae | Moraceae | Ficus microcarpa | Ref. |
Plantae | Moraceae | Morus australis | Ref. |
Plantae | Myricaceae | Myrica rubra | Ref. |
Plantae | Myrtaceae | Eucalyptus citriodora | Ref. |
Plantae | Myrtaceae | Eucalyptus tereticornis | Ref. |
Plantae | Myrtaceae | Leptospermum scoparium | Ref. |
Plantae | Myrtaceae | Melaleuca ericifolia | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendron | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Myrtaceae | Syzygium buxifolium | Ref. |
Plantae | Myrtaceae | Syzygium formosanum | Ref. |
Plantae | Oleaceae | Forsythia suspensa | Ref. |
Plantae | Oleaceae | Ligustrum lucidum | Ref. |
Plantae | Oleaceae | Phillyrea latifolia L. | Ref. |
Plantae | Onagraceae | Ludwigia octovalvis | Ref. |
Plantae | Paulowniaceae | Paulownia tomentosa | Ref. |
Plantae | Pinaceae | Pinus roxburghii | Ref. |
Plantae | Plantaginaceae | Plantago asiatica | Ref. |
Plantae | Plantaginaceae | Plantago depressa | Ref. |
Plantae | Plantaginaceae | Plantago major | Ref. |
Plantae | Polygonaceae | Coccoloba excoriata | Ref. |
Plantae | Rhamnaceae | Ziziphus jujuba | Ref. |
Plantae | Rhamnaceae | Ziziphus jujuba var.spinosa | Ref. |
Plantae | Rosaceae | Chaenomeles sinensis | Ref. |
Plantae | Rosaceae | Crataegus cuneata | Ref. |
Plantae | Rosaceae | Crataegus hupehensis | Ref. |
Plantae | Rosaceae | Crataegus pinnatifida | Ref. |
Plantae | Rosaceae | Crataegus pinnatifida var.major | Ref. |
Plantae | Rosaceae | Eriobotrya japonica | Ref. |
Plantae | Rosaceae | Photinia serrulata | Ref. |
Plantae | Rosaceae | Potentilla chinensis | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rosaceae | Prunus serotina | Ref. |
Plantae | Rosaceae | Rosa multiflora | Ref. |
Plantae | Rosaceae | Rubus ellipticus | Ref. |
Plantae | Rubiaceae | Coussarea paniculata | Ref. |
Plantae | Rubiaceae | Gardenia jasminoides | Ref. |
Plantae | Rubiaceae | Hedyotis dichotoma | Ref. |
Plantae | Rubiaceae | Hedyotis herbacea | Ref. |
Plantae | Rubiaceae | Lasianthus gardneri | Ref. |
Plantae | Rubiaceae | Mitragyna speciosa | Ref. |
Plantae | Rubiaceae | Mitragyna stipulosa | Ref. |
Plantae | Rubiaceae | Morinda citrifolia | Ref. |
Plantae | Rubiaceae | Morinda officinalis | Ref. |
Plantae | Rubiaceae | Morinda tinctoria var.tomentosa. | Ref. |
Plantae | Rubiaceae | Oldenlandia diffusa | Ref. |
Plantae | Rubiaceae | Ophiorrhiza liukiuensis | Ref. |
Plantae | Rubiaceae | Rubia wallichiana | Ref. |
Plantae | Rubiaceae | Uncaria tomentosa | Ref. |
Plantae | Rutaceae | Phellodendron amurense | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana laxiflora | Ref. |
Plantae | Verbenaceae | Verbena littoralis | Ref. |
Plantae | Verbenaceae | Verbena officinalis | Ref. |
- | - | Aganosma caryophyllata | Ref. |
- | - | Clerodendranthus spicatus | Ref. |
- | - | Hex aquifolium | Ref. |
|
|
zoom in
Organism | Leptospermum scoparium | Reference | Aldrich Library of 13C and 1H FT NMR Spectra,3,(1992),595A |
---|
|