Name |
4-Caffeoylquinic acid Cryptochlorogenic acid 4-O-Caffeoylquinic acid |
Formula |
C16H18O9 |
Mw |
354.09508217 |
CAS RN |
905-99-7 |
C_ID |
C00029540
,
|
InChIKey |
GYFFKZTYYAFCTR-PCEXOASVNA-N |
InChICode |
InChI=1S/C16H18O9/c17-9-3-1-8(5-10(9)18)2-4-13(21)25-14-11(19)6-16(24,15(22)23)7-12(14)20/h1-5,11-12,14,17-20,24H,6-7H2,(H,22,23)/b4-2+/t11-,12-,14-,16+/m1/s1 |
SMILES |
c1(cc(c(cc1)O)O)/C=C/C(=O)O[C@H]1[C@@H](C[C@](C[C@H]1O)(O)C(=O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Cynara scolymus | Ref. |
Plantae | Asteraceae | Helianthus annuus | Ref. |
Plantae | Asteraceae | Helianthus sp. | Ref. |
Plantae | Asteraceae | Matricaria recutita | Ref. |
Plantae | Asteraceae | Solidago altissima L. | Ref. |
Plantae | Chloranthaceae | Sarcandra glabra | Ref. |
Plantae | Convolvulaceae | Ipomoea batatas | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Moraceae | Morus alba | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrina | Ref. |
Plantae | Moringaceae | Moringa peregrine | Ref. |
Plantae | Moringaceae | Moringa stenopetala | Ref. |
Plantae | Rosaceae | Cydonia oblonga | Ref. |
Plantae | Rosaceae | Eriobotrya japonica | Ref. |
Plantae | Rosaceae | Prunus domestica | Ref. |
Plantae | Rubiaceae | Coffea sp. | Ref. |
Plantae | Solanaceae | Solanum habrochaites | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Solanaceae | Solanum neorickii | Ref. |
Plantae | Solanaceae | Solanum parviflorum | Ref. |
Plantae | Solanaceae | Solanum pennellii | Ref. |
Plantae | Solanaceae | Solanum pimpinellifollium | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
- | - | Caffea sp. | Ref. |
|
|
zoom in
Organism | Moringa oleifera | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|