Name |
1-Octen-3-ol Oct-1-en-3-ol |
Formula |
C8H16O |
Mw |
128.12011513 |
CAS RN |
3391-86-4 |
C_ID |
C00029423
,
|
InChIKey |
VSMOENVRRABVKN-UHFFFAOYNA-N |
InChICode |
InChI=1S/C8H16O/c1-3-5-6-7-8(9)4-2/h4,8-9H,2-3,5-7H2,1H3/t8-/m1/s1 |
SMILES |
C(=C)[C@@H](O)CCCCC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Fungi | Polyporaceae | Lentinus edodes Sing. | Ref. |
Fungi | Tricholomataceae | Tricholoma matsutake | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Sophora japonica | Ref. |
Plantae | Fabaceae | Tipuana tipu | Ref. |
Plantae | Gymnomitriaceae | Marsupella alpina | Ref. |
Plantae | Labiatae | Clinopodium nepeta | Ref. |
Plantae | Labiatae | Melissa officinalis | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Schizonepeta temuifolia | Ref. |
Plantae | Labiatae | Thymus broussonetti | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Labiatae | Thymus maroccanus | Ref. |
Plantae | Labiatae | Thymus praecos | Ref. |
Plantae | Lamiaceae | Calamintha nepeta subsp. glandulosa | Ref. |
Plantae | Laminariaceae | Laminaria japonica | Ref. |
Plantae | Plantaginaceae | Plantago lanceolata | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rubiaceae | Coffea arabica | Ref. |
Plantae | Rubiaceae | Coffea canephora | Ref. |
Plantae | Scrophulariaceae | Scrophularia amplexicaulis | Ref. |
Plantae | Scrophulariaceae | Scrophularia oxysepala | Ref. |
Plantae | Solanaceae | Mandragora autumnalis | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
- | - | Cow (Breath) | Ref. |
- | - | Tuber borchii | Ref. |
- | - | Tuber brumale | Ref. |
- | - | Tuber excavatum | Ref. |
- | - | Tuber indicum | Ref. |
- | - | Tuber magnatum | Ref. |
- | - | Tuber melanosporum | Ref. |
- | - | Tuber mesentericum | Ref. |
- | - | Tuber oligospermum | Ref. |
- | - | Tuber panniferum | Ref. |
- | - | Tuber rufum | Ref. |
- | - | Tuber uncinatum | Ref. |
|
|
zoom in
Organism | Scrophularia oxysepala | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|