| Name |
(E)-Methyl-4-hydroxy-3-methoxycinnamate
Methyl (E)-ferulate
Methyl trans-ferulate |
| Formula |
C11H12O4 |
| Mw |
208.07355887 |
| CAS RN |
22329-76-6 |
| C_ID |
C00029337
, 
|
| InChIKey |
AUJXJFHANFIVKH-GQCTYLIASA-N |
| InChICode |
InChI=1S/C11H12O4/c1-14-10-7-8(3-5-9(10)12)4-6-11(13)15-2/h3-7,12H,1-2H3/b6-4+ |
| SMILES |
COC(=O)/C=C/c1ccc(O)c(OC)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ligularia dentata Hara | Ref. |
| Plantae | Asteraceae | Taraxacum formosanum | Ref. |
| Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
| Plantae | Rubiaceae | Palicourea coriacea | Ref. |
| Plantae | Rutaceae | Atalantia buxifolia | Ref. |
| Plantae | Rutaceae | Phellodendron amurense var.wilsonii  | Ref. |
|
|
zoom in
| Organism | Phellodendron amurense var.wilsonii |
|---|
| Reference | Wu, et al., Chem Pharm Bull, 53, (2005), 56.
Wu, et al., Journal of Natural Products, 64, (2001), 1040.
LEU, et al., Chem Pharm Bull, 53, (2005), 853.
Wu, et al., Journal of Natural Products, 66, (2003), 1207 |
|---|
|
