Name |
Quinoline |
Formula |
C9H7N |
Mw |
129.05784923 |
CAS RN |
91-22-5 |
C_ID |
C00026478
,
|
InChIKey |
SMWDFEZZVXVKRB-UHFFFAOYSA-N |
InChICode |
InChI=1S/C9H7N/c1-2-6-9-8(4-1)5-3-7-10-9/h1-7H |
SMILES |
c1cccc2c1nccc2 |
Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate L-Asp |
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Cucurbitaceae | Citrullus colocynthis | Ref. |
Plantae | Fabaceae | Mucuna puriens | Ref. |
Plantae | Labiatae | Mentha spp | Ref. |
Plantae | Labiatae | Mentha spp. | Ref. |
Plantae | Rubiaceae | Cinchona ledgeriana | Ref. |
Plantae | Rutaceae | Citrus aurantium | Ref. |
Plantae | Rutaceae | Galipea officnalis | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
- | - | Angostura trifoliata | Ref. |
- | - | Oreophoetes peruana | Ref. |
|
|
zoom in
Organism | Cinchona ledgeriana | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|