Name |
l-Scoulerine Scoulerine (-)-Scoulerine (S)-Scoulerine |
Formula |
C19H21NO4 |
Mw |
327.14705817 |
CAS RN |
6451-73-6 |
C_ID |
C00026092
,
|
InChIKey |
KNWVMRVOBAFFMH-GGYSOQFKNA-N |
InChICode |
InChI=1S/C19H21NO4/c1-23-17-4-3-11-7-15-13-9-16(21)18(24-2)8-12(13)5-6-20(15)10-14(11)19(17)22/h3-4,8-9,15,21-22H,5-7,10H2,1-2H3/t15-/m0/s1 |
SMILES |
c12c(CN3[C@@H](C1)c1c(CC3)cc(c(c1)O)OC)c(c(cc2)OC)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Disepalum pulchrum | Ref. |
Plantae | Berberidaceae | Berberis aquifolium | Ref. |
Plantae | Berberidaceae | Berberis aristata | Ref. |
Plantae | Berberidaceae | Berberis thunbergii | Ref. |
Plantae | Berberidaceae | Berberis vulgaris | Ref. |
Plantae | Berberidaceae | Berberis wilsoniae | Ref. |
Plantae | Berberidaceae | Mahonia aquifolium | Ref. |
Plantae | Fabaceae | Erythrina orientalis Murr. | Ref. |
Plantae | Fumariaceae | Corydalis bungeana | Ref. |
Plantae | Fumariaceae | Corydalis caseana A.Gray. | Ref. |
Plantae | Fumariaceae | Corydalis caucasia | Ref. |
Plantae | Fumariaceae | Corydalis cava | Ref. |
Plantae | Fumariaceae | Corydalis gigantea Trautv.et Mey. | Ref. |
Plantae | Fumariaceae | Corydalis hsuchowensis | Ref. |
Plantae | Fumariaceae | Corydalis incisa | Ref. |
Plantae | Fumariaceae | Corydalis intermedia | Ref. |
Plantae | Fumariaceae | Corydalis majori | Ref. |
Plantae | Fumariaceae | Corydalis nobilis | Ref. |
Plantae | Fumariaceae | Corydalis pallida | Ref. |
Plantae | Fumariaceae | Corydalis pseudoadunca | Ref. |
Plantae | Fumariaceae | Corydalis sibirica Pers. | Ref. |
Plantae | Fumariaceae | Corydalis solida | Ref. |
Plantae | Fumariaceae | Corydalis stewartii | Ref. |
Plantae | Fumariaceae | Corydalis yanhusuo | Ref. |
Plantae | Fumariaceae | Dicentra spectabilis | Ref. |
Plantae | Fumariaceae | Fumaria asepala | Ref. |
Plantae | Fumariaceae | Fumaria bella | Ref. |
Plantae | Fumariaceae | Fumaria capreolata | Ref. |
Plantae | Fumariaceae | Fumaria cilicica | Ref. |
Plantae | Fumariaceae | Fumaria densiflora | Ref. |
Plantae | Fumariaceae | Fumaria judaica | Ref. |
Plantae | Fumariaceae | Fumaria kralikii | Ref. |
Plantae | Fumariaceae | Fumaria officinalis | Ref. |
Plantae | Fumariaceae | Hypecoum procumbens L. | Ref. |
Plantae | Fumariaceae | Sarcocapnos enneaphylla | Ref. |
Plantae | Fumariaceae | Sarcocapnos saetabensis | Ref. |
Plantae | Lauraceae | Cryptocarya longifolia Kostermans | Ref. |
Plantae | Menispermaceae | Stephania cepharantha Hayata | Ref. |
Plantae | Papaveraceae | Argemone mexicana | Ref. |
Plantae | Papaveraceae | Chelidonium majus | Ref. |
Plantae | Papaveraceae | Eschscholzia californica | Ref. |
Plantae | Papaveraceae | Glaucium flavum | Ref. |
Plantae | Papaveraceae | Hunnemannia fumariaefolia Sweet | Ref. |
Plantae | Papaveraceae | Macleaya cordata | Ref. |
Plantae | Papaveraceae | Meconopsis cambrica | Ref. |
Plantae | Papaveraceae | Papaver albiflora | Ref. |
Plantae | Papaveraceae | Papaver albiflorum (sub.spp.albiflorum austromoravicum) | Ref. |
Plantae | Papaveraceae | Papaver bracteatum | Ref. |
Plantae | Papaveraceae | Papaver confine | Ref. |
Plantae | Papaveraceae | Papaver lecoquii Lamotte | Ref. |
Plantae | Papaveraceae | Papaver orientale | Ref. |
Plantae | Papaveraceae | Papaver pinnatifidum | Ref. |
Plantae | Papaveraceae | Papaver rhoeas chelidonides | Ref. |
Plantae | Papaveraceae | Papaver setigerum | Ref. |
Plantae | Papaveraceae | Papaver somniferum L. | Ref. |
Plantae | Papaveraceae | Papaver stevenianum | Ref. |
Plantae | Papaveraceae | Papaver tauricola | Ref. |
Plantae | Papaveraceae | Papaver trinifolium | Ref. |
Plantae | Papaveraceae | Papaver triniifolium | Ref. |
Plantae | Papaveraceae | Stylophorum lasiocarpum | Ref. |
Plantae | Ranunculaceae | Coptis japonica | Ref. |
Plantae | Ranunculaceae | Thalictrum flavum | Ref. |
Plantae | Ranunculaceae/Hydrastidaceae | Hydrastis canadensis | Ref. |
Plantae | Rutaceae | Phellodendron chinensis | Ref. |
Plantae | Rutaceae | Zanthoxylum taediosum | Ref. |
- | - | Fumaris vaillantii Loisel. | Ref. |
- | - | Mohonia bealei | Ref. |
|
|
zoom in
Organism | Fumaria capreolata | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|