Name |
Viridiflorene Ledene Ledene Oxide |
Formula |
C15H24 |
Mw |
204.18780077 |
CAS RN |
21747-46-6 |
C_ID |
C00021220
,
|
InChIKey |
WGTRJVCFDUCKCM-PKIJNGNFNA-N |
InChICode |
InChI=1S/C15H24/c1-9-6-8-12-14(15(12,3)4)13-10(2)5-7-11(9)13/h10,12-14H,5-8H2,1-4H3/t10-,12+,13+,14-/m0/s1 |
SMILES |
CC1=C2CC[C@@H](C)C2[C@H]2[C@@H](CC1)C2(C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Araliaceae | Panax ginseng | Ref. |
Plantae | Asteraceae | Ageratina conyzoides | Ref. |
Plantae | Asteraceae | Phagnalon sordidum | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Fabaceae | Rhynchosia minima | Ref. |
Plantae | Jubulaceae | Frullania ptychantha | Ref. |
Plantae | Labiatae | Ocimum sanctum | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Labiatae | Thymus broussonetti | Ref. |
Plantae | Labiatae | Thymus maroccanus | Ref. |
Plantae | Labiatae | Thymus praecos | Ref. |
Plantae | Lauraceae | Laurus nobilis | Ref. |
Plantae | Lepidoziaceae | Bazzania trilobata L. | Ref. |
Plantae | Lepidoziaceae | Lepidozia vitrea | Ref. |
Plantae | Meliaceae | Azadirachta indica | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Myrtaceae | Eucalyptus microtheca | Ref. |
Plantae | Myrtaceae | Leptospermum scoparium | Ref. |
Plantae | Myrtaceae | Melaleuca alternifolia | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendra L. | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendron | Ref. |
Plantae | Piperaceae | Piper nigrum | Ref. |
Plantae | Rutaceae | Atalantia guillauminii | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
|
|
zoom in
Organism | Thymus broussonetti | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|