Name |
3-O-beta-D-Glucopyranosyl sitosterol beta-Sitosterol glucoside beta-sitosterol-3-beta-O-D-glucopyranoside beta-Sitosterol-3-O-beta-D-glucoside beta-Sitosterol 3-O-beta-D-glucopyranoside Daucosterin Doursterol beta-Sitosteryl-glucoside Daucosterol beta-Daucosterol beta-Sitosterol 3-O-beta-glucopyranoside beta-Sitosteryl glucoside Sitosterol glucoside |
Formula |
C35H60O6 |
Mw |
576.43898965 |
CAS RN |
474-58-8 |
C_ID |
C00019308
,
|
InChIKey |
NPJICTMALKLTFW-ZWEMWMMCNA-N |
InChICode |
InChI=1S/C35H60O6/c1-7-22(20(2)3)9-8-21(4)26-12-13-27-25-11-10-23-18-24(14-16-34(23,5)28(25)15-17-35(26,27)6)40-33-32(39)31(38)30(37)29(19-36)41-33/h10,20-22,24-33,36-39H,7-9,11-19H2,1-6H3/t21-,22-,24+,25+,26-,27+,28+,29+,30-,31+,32-,33-,34+,35-/m1/s1 |
SMILES |
C1[C@@H](CC2=CC[C@@H]3[C@@H]([C@]2(C1)C)CC[C@]1([C@H]3CC[C@@H]1[C@@H](CC[C@H](C(C)C)CC)C)C)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)CO)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Dicliptera riparia | Ref. |
Plantae | Agavaceae | Agave americana | Ref. |
Plantae | Anacardiaceae | Rhus wallichi | Ref. |
Plantae | Annonaceae | Annona purpurea | Ref. |
Plantae | Annonaceae | Artabotrys uncinatus | Ref. |
Plantae | Apiaceae | Ferula persica | Ref. |
Plantae | Apiaceae | Heracleum granatense | Ref. |
Plantae | Apocynaceae | Cryptolepis obtusa | Ref. |
Plantae | Araliaceae | Centella asiatica | Ref. |
Plantae | Araliaceae | Hedera nepalensis K.Koch | Ref. |
Plantae | Araliaceae | Panax notoginseng | Ref. |
Plantae | Araliaceae | Schefflera capitata Harms. | Ref. |
Plantae | Aristolochiaceae | Aristolochia heterophylla | Ref. |
Plantae | Aristolochiaceae | Aristolochia kaempferi | Ref. |
Plantae | Asparagaceae | Asparagus officinalis | Ref. |
Plantae | Asteraceae | Achillea ageratum | Ref. |
Plantae | Asteraceae | Ajania fruticulosa | Ref. |
Plantae | Asteraceae | Artemisia minor | Ref. |
Plantae | Asteraceae | Artemisia sieversiana | Ref. |
Plantae | Asteraceae | Centaurea bracteata Scop. | Ref. |
Plantae | Asteraceae | Eupatorium adenophorum | Ref. |
Plantae | Asteraceae | Eupatorium macrocephalum Lee. | Ref. |
Plantae | Asteraceae | Gonospermum elegans | Ref. |
Plantae | Asteraceae | Inula cappa | Ref. |
Plantae | Asteraceae | Inula racemosa | Ref. |
Plantae | Asteraceae | Inula viscosa | Ref. |
Plantae | Asteraceae | Robinsonecio gerberifolius | Ref. |
Plantae | Asteraceae | Senecio chionophilus | Ref. |
Plantae | Asteraceae | Taraxacum formosanum | Ref. |
Plantae | Asteraceae | Viguiera decurrens | Ref. |
Plantae | Balanophoraceae | Balanophora abbreviata B1 | Ref. |
Plantae | Begoniaceae | Begonia nantoensis | Ref. |
Plantae | Berberidaceae | Berberis pseudanubalata | Ref. |
Plantae | Bignoniaceae | Newbouldia laevis | Ref. |
Plantae | Blechnaceae | Stenochlaena palustris | Ref. |
Plantae | Canellaceae | Canella winterana | Ref. |
Plantae | Capparaceae | Capparis aegyptia | Ref. |
Plantae | Capparaceae | Capparis deserti | Ref. |
Plantae | Capparaceae | Capparis leucophylla | Ref. |
Plantae | Cecropiaceae | Myrianthus arboreus | Ref. |
Plantae | Celastraceae | Tripterygium wilfordii | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Clusia nemorosa | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia griffithii | Ref. |
Plantae | Combretaceae | Combretum quadrangulare | Ref. |
Plantae | Connaraceae | Rourea minor | Ref. |
Plantae | Convallariaceae | Disporopsis aspera | Ref. |
Plantae | Convolvulaceae | Erycibe expansa | Ref. |
Plantae | Convolvulaceae | Pharbitis nil | Ref. |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Cucurbitaceae | Gymnopetalum integrifolium | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Dennstaedtiaceae | Pteridium aquilinum | Ref. |
Plantae | Dioscoreaceae | Dioscorea spongiosa | Ref. |
Plantae | Dryopteridaceae | Dryopteris crassirhizoma | Ref. |
Plantae | Ebenaceae | Diospyros rhodocalyx | Ref. |
Plantae | Ephedraceae | Ephedra sinica | Ref. |
Plantae | Euphorbiaceae | Alchornea cordifolia | Ref. |
Plantae | Euphorbiaceae | Croton lechleri Mull.Arg. | Ref. |
Plantae | Euphorbiaceae | Croton urucurana Baill. | Ref. |
Plantae | Euphorbiaceae | Euphorbia boetica | Ref. |
Plantae | Euphorbiaceae | Euphorbia lanata | Ref. |
Plantae | Euphorbiaceae | Euphorbia tinctoria | Ref. |
Plantae | Fabaceae | Cassia javanica | Ref. |
Plantae | Fabaceae | Centrosema pubescens | Ref. |
Plantae | Fabaceae | Millettia conraui | Ref. |
Plantae | Fabaceae | Millettia pinnata | Ref. |
Plantae | Fabaceae | Piptadenia macrocarpa | Ref. |
Plantae | Fabaceae | Saraca asoca | Ref. |
Plantae | Fabaceae | Swartzia brachyrachis | Ref. |
Plantae | Fabaceae | Trifolium resupinatum | Ref. |
Plantae | Gentianaceae | Gentiana lutea L. | Ref. |
Plantae | Geraniaceae | Geranium macrorrhizum L. | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Gnetaceae | Gnetum cleistostachyum | Ref. |
Plantae | Gnetaceae | Gnetum pendulum C.Y. | Ref. |
Plantae | Hydrangeaceae | Hydrangea chinensis | Ref. |
Plantae | Hydrangeaceae | Pileostegia viburnoides var. glabrescens | Ref. |
Plantae | Hydrocharitaceae | Enhalus acoroides | Ref. |
Plantae | Hypoxidaceae | Curculigo capitulata | Ref. |
Plantae | Labiatae | Callicarpa macrophylla | Ref. |
Plantae | Labiatae | Hyptis brevipes | Ref. |
Plantae | Labiatae | Isodon phyllostachys | Ref. |
Plantae | Labiatae | Salvia aethiopis | Ref. |
Plantae | Labiatae | Salvia canariensis L. | Ref. |
Plantae | Labiatae | Satureja acinos | Ref. |
Plantae | Labiatae | Schnabelia tetradonta | Ref. |
Plantae | Labiatae | Vitex trifolia | Ref. |
Plantae | Lauraceae | Beilschmiedia zenkeri | Ref. |
Plantae | Lauraceae | Cinnamomum camphora | Ref. |
Plantae | Lauraceae | Machilus zuihoensis | Ref. |
Plantae | Loranthaceae | Psittacanthus cucullaris | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Magnoliaceae | Magnolia obovata | Ref. |
Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
Plantae | Melanthiaceae | Veratrum album | Ref. |
Plantae | Meliaceae | Aglaia rubiginosa | Ref. |
Plantae | Meliaceae | Cipadessa cinerascens | Ref. |
Plantae | Meliaceae | Khaya anthotheca | Ref. |
Plantae | Meliaceae | Toona sinensis | Ref. |
Plantae | Meliaceae | Xylocarpus granatum | Ref. |
Plantae | Melianthaceae | Melianthus major | Ref. |
Plantae | Menispermaceae | Macrococculus pomiferus | Ref. |
Plantae | Moraceae | Ficus septica | Ref. |
Plantae | Moraceae | Morus insignis | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrina | Ref. |
Plantae | Myrsinaceae | Embelia ribes Burm. | Ref. |
Plantae | Myrtaceae | Eucalyptus camaldulensis var.obtusa | Ref. |
Plantae | Myrtaceae | Eugenia sandwicensis | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Myrtaceae | Syzygium aromaticum | Ref. |
Plantae | Orchidaceae | Dendrobium nobile Lindl. | Ref. |
Plantae | Paeoniaceae | Paeonia suffruticosa | Ref. |
Plantae | Palmae | Borassus flabellifer | Ref. |
Plantae | Phyllanthaceae | Phyllanthus oligospermus | Ref. |
Plantae | Picramniaceae | Picramnia latifolia | Ref. |
Plantae | Piperaceae | Piper nigrum L. | Ref. |
Plantae | Piperaceae | Piper umbellatum | Ref. |
Plantae | Plumbaginaceae | Plumbago zeylanica | Ref. |
Plantae | Polygonaceae | Rumex nepalensis | Ref. |
Plantae | Primulaceae | Primula macrophylla | Ref. |
Plantae | Pteridaceae | Pteris multifida | Ref. |
Plantae | Rosaceae | Chaenomeles japonica | Ref. |
Plantae | Rosaceae | Rubus ellipticus | Ref. |
Plantae | Rosaceae | Spiraea formosana | Ref. |
Plantae | Rubiaceae | Chione venosa (sw.) Urban var.venosa | Ref. |
Plantae | Rubiaceae | Mitragyna inermis | Ref. |
Plantae | Rubiaceae | Mitragyna rotundifolia | Ref. |
Plantae | Rubiaceae | Mitragyna speciosa | Ref. |
Plantae | Rubiaceae | Mitragyna stipulosa | Ref. |
Plantae | Rubiaceae | Morinda citrifolia | Ref. |
Plantae | Rubiaceae | Morinda officinalis | Ref. |
Plantae | Rubiaceae | Ophiorrhiza liukiuensis | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Zanthoxylum armatum | Ref. |
Plantae | Santalaceae | Viscum coloratum | Ref. |
Plantae | Schisandraceae | Kadsura heteroclita | Ref. |
Plantae | Scrophulariaceae | Scrophularia ningpoensis | Ref. |
Plantae | Smilacaceae | Smilax china | Ref. |
Plantae | Solanaceae | Hyoscyamus niger | Ref. |
Plantae | Solanaceae | Solanum melongena | Ref. |
Plantae | Solanaceae | Withania somnifera | Ref. |
Plantae | Stilbaceae | Nuxia sphaerocephala | Ref. |
Plantae | Taxaceae | Taxus wallichiana | Ref. |
Plantae | Trochodendraceae/Tetracentraceae | Tetracentron sinense | Ref. |
Plantae | Verbenaceae | Lantana camara | Ref. |
Plantae | Verbenaceae | Verbena brasiliensis VELL | Ref. |
Plantae | Verbenaceae | Verbena officinalis | Ref. |
Plantae | Zingiberaceae | Alpinia blepharocalyx | Ref. |
Plantae | Zingiberaceae | Alpinia pinnanensis | Ref. |
Plantae | Zingiberaceae | Zingiber aromaticum | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
Plantae | Zygophyllaceae | Tribulus terrestris | Ref. |
- | - | Aceraceae nikoense | Ref. |
- | - | Moghania macrophylla | Ref. |
|
|
zoom in
Organism | Moringa peregrina | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|