Name |
Tricetin 5,7,3',4',5'-Pentahydroxyflavone 5,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-4-one |
Formula |
C15H10O7 |
Mw |
302.04265268 |
CAS RN |
520-31-0 |
C_ID |
C00013328
,
|
InChIKey |
ARSRJFRKVXALTF-UHFFFAOYSA-N |
InChICode |
InChI=1S/C15H10O7/c16-7-3-8(17)14-9(18)5-12(22-13(14)4-7)6-1-10(19)15(21)11(20)2-6/h1-5,16-17,19-21H |
SMILES |
c12c(cc(cc1O)O)oc(cc2=O)c1cc(c(c(c1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Boraginaceae | Heliotropium subulatum | Ref. |
Plantae | Boraginaceae | Heliotropium taltalense | Ref. |
Plantae | Caryophyllaceae | Stellaria media | Ref. |
Plantae | Fabaceae | Lens culinaris | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Myrtaceae | Eucalyptus globulus | Ref. |
Plantae | Myrtaceae | Kunzea ericoides | Ref. |
Plantae | Myrtaceae | Leptospermum scoparium | Ref. |
Plantae | Myrtaceae | Metrosideros excelsa | Ref. |
Plantae | Myrtaceae | Metrosideros umbellata | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Taxaceae | Taxus fuana | Ref. |
Plantae | Taxaceae | Taxus yunnanensis | Ref. |
|
|
zoom in
Organism | Heliotropium subulatum | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|