| Name |
(+)-Alantolactone
Alant camphor
Elecampane camphor
Eupatal
Inula camphor
Alantolactone |
| Formula |
C15H20O2 |
| Mw |
232.14632988 |
| CAS RN |
546-43-0 |
| C_ID |
C00012893
, 
|
| InChIKey |
PXOYOCNNSUAQNS-ADKIRLCKNA-N |
| InChICode |
InChI=1S/C15H20O2/c1-9-5-4-6-15(3)8-13-11(7-12(9)15)10(2)14(16)17-13/h7,9,11,13H,2,4-6,8H2,1,3H3/t9-,11+,13+,15+/m0/s1 |
| SMILES |
C=C1C(=O)O[C@@H]2C[C@@]3(C)CCC[C@H](C)C3=C[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ajania fruticulosa  | Ref. |
| Plantae | Asteraceae | Inula grandis | Ref. |
| Plantae | Asteraceae | Inula helenium | Ref. |
| Plantae | Asteraceae | Inula magnifica | Ref. |
| Plantae | Asteraceae | Inula racemosa | Ref. |
| Plantae | Asteraceae | Inula royleana | Ref. |
| Plantae | Asteraceae | Inula salicina | Ref. |
| Plantae | Asteraceae | Saussurea lappa | Ref. |
| Plantae | Asteraceae | Tagetes patula | Ref. |
| Plantae | Malvaceae | Abutilon indicum | Ref. |
| Plantae | Rosaceae | Kerria japonica | Ref. |
|
|
zoom in
| Organism | Kerria japonica |
|---|
| Reference | Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
|---|
|
