Name |
Festuclavin Festuclavine |
Formula |
C16H20N2 |
Mw |
240.16264865 |
CAS RN |
569-26-6 |
C_ID |
C00011209
,
|
InChIKey |
VLMZMRDOMOGGFA-SPHRCPJVNA-N |
InChICode |
InChI=1S/C16H20N2/c1-10-6-13-12-4-3-5-14-16(12)11(8-17-14)7-15(13)18(2)9-10/h3-5,8,10,13,15,17H,6-7,9H2,1-2H3/t10-,13-,15-/m1/s1 |
SMILES |
c1c2c3c(cc1)[C@@H]1[C@@H](Cc3c[nH]2)N(C[C@@H](C1)C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Fungi | Clavicipitaceae | Claviceps africana | Ref. |
Fungi | Clavicipitaceae | Claviceps gigontea | Ref. |
Fungi | Trichocomaceae | Aspergillus fumigatus | Ref. |
Fungi | Trichocomaceae | Neosartorya fumigata | Ref. |
Fungi | Trichocomaceae | Penicillium chermesinum | Ref. |
Fungi | Trichocomaceae | Penicillium commune | Ref. |
Plantae | Convolvulaceae | Argyreia nervosa | Ref. |
Plantae | Poaceae | Festuca rubra | Ref. |
Plantae | Poaceae | Trisetum bifidum Ohwi | Ref. |
- | - | Agropyrum semicostatum | Ref. |
- | - | Aspergullus fumigatus | Ref. |
- | - | Neosartarya fumigata Af293 | Ref. |
|
|
zoom in
Organism | Festuca rubra | Reference | Cole,Handbook of Secondary Fungal Metabolites,Volume I,(2003)
Berde,Handbook of Experimental Pharmacology,Springer-Verlag New York,(1978) |
---|
|