Name |
Ellagic acid Gallogen Alizarin yellow Elagostasine |
Formula |
C14H6O8 |
Mw |
302.00626717 |
CAS RN |
476-66-4 |
C_ID |
C00011153
, 
|
InChIKey |
AFSDNFLWKVMVRB-UHFFFAOYSA-N |
InChICode |
InChI=1S/C14H6O8/c15-5-1-3-7-8-4(14(20)22-11(7)9(5)17)2-6(16)10(18)12(8)21-13(3)19/h1-2,15-18H |
SMILES |
c1c2c3c(c(c1O)O)oc(=O)c1c3c(oc2=O)c(c(c1)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Mangifera indica  | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
Plantae | Casuarinaceae | Casuarina cunninghamiana Miq. | Ref. |
Plantae | Casuarinaceae | Casuarina equisetifolia L.  | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Combretaceae | Combretum yunnanensis | Ref. |
Plantae | Combretaceae | Terminalia chebula  | Ref. |
Plantae | Combretaceae | Terminalia superba  | Ref. |
Plantae | Cunoniaceae | Cunonia macrophylla | Ref. |
Plantae | Euphorbiaceae | Euphorbia hirta  | Ref. |
Plantae | Euphorbiaceae | Macaranga barteri | Ref. |
Plantae | Fabaceae | Acacia nilotica  | Ref. |
Plantae | Fagaceae | Castanea sativa  | Ref. |
Plantae | Fagaceae | Quercus alba  | Ref. |
Plantae | Fagaceae | Quercus infectoria  | Ref. |
Plantae | Fagaceae | Quercus robur  | Ref. |
Plantae | Geraniaceae | Geranium sibiricum  | Ref. |
Plantae | Geraniaceae | Geranium thunbergii | Ref. |
Plantae | Haloragaceae | Myriophyllum spicatum | Ref. |
Plantae | Juglandaceae | Platycarya strobilacea | Ref. |
Plantae | Labiatae | Satureja subspicata  | Ref. |
Plantae | Lythraceae | Lagerstroemia indica  | Ref. |
Plantae | Lythraceae | Lythrum salicaria  | Ref. |
Plantae | Lythraceae | Punica granatum  | Ref. |
Plantae | Melastomataceae | Miconia myriantha | Ref. |
Plantae | Meliaceae | Azadirachta indica  | Ref. |
Plantae | Moringaceae | Moringa oleifera  | Ref. |
Plantae | Moringaceae | Moringa peregrine | Ref. |
Plantae | Moringaceae | Moringa stenopetala  | Ref. |
Plantae | Myrtaceae | Eucalyptus citriodora  | Ref. |
Plantae | Myrtaceae | Eugenia crebrinervis | Ref. |
Plantae | Myrtaceae | Eugenia gustavioides | Ref. |
Plantae | Myrtaceae | Eugenia jambolana  | Ref. |
Plantae | Myrtaceae | Kunzea ambigua | Ref. |
Plantae | Myrtaceae | Myrciaria cauliflora  | Ref. |
Plantae | Myrtaceae | Psidium guajava  | Ref. |
Plantae | Myrtaceae | Syzygium aromaticum  | Ref. |
Plantae | Myrtaceae | Syzygium cumini  | Ref. |
Plantae | Nymphaeaceae | Nymphaea alba  | Ref. |
Plantae | Phyllanthaceae | Emblica officinalis  | Ref. |
Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
Plantae | Pinaceae | Pinus roxburghii  | Ref. |
Plantae | Rosaceae | Agrimonia pilosa var.japonica  | Ref. |
Plantae | Rosaceae | Cowania mexicana  | Ref. |
Plantae | Rosaceae | Rubus idaeus L.  | Ref. |
Plantae | Saxifragaceae | Saxifraga azizoon | Ref. |
Plantae | Solanaceae | Capsicum annuum  | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Taxodiaceae | Taxodium lanceolata | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
- | - | Aceraceae nikoense | Ref. |
- | - | Chamaenerion angustifolium | Ref. |
- | - | Flueggea microcarpa  | Ref. |
- | - | terminalia bellirica | Ref. |
|
|
zoom in
Organism | Moringa peregrine | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|