Name |
4-Isopropenyl-1-methylbenzene alpha,4-Dimethylstyrene p-Cymenene p-Isopropenyltoluene p-Isopropenyl toluene Dehydro-p-cymene |
Formula |
C10H12 |
Mw |
132.09390038 |
CAS RN |
1195-32-0 |
C_ID |
C00010905
,
|
InChIKey |
MMSLOZQEMPDGPI-UHFFFAOYSA-N |
InChICode |
InChI=1S/C10H12/c1-8(2)10-6-4-9(3)5-7-10/h4-7H,1H2,2-3H3 |
SMILES |
c1cc(ccc1C)C(=C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Fungi | Trichocomaceae | Penicillium expansum | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Apiaceae | Petroselinum crispum | Ref. |
Plantae | Asteraceae | Phagnalon sordidum | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Cupressaceae | Chamaecyparis sp. | Ref. |
Plantae | Cupressaceae | Juniperus sp. | Ref. |
Plantae | Grossulariaceae | Ribes sp. | Ref. |
Plantae | Grossulariaceae | Ribes spp. | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Thymus broussonetti | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Labiatae | Thymus maroccanus | Ref. |
Plantae | Labiatae | Thymus praecos | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Myrtaceae | Eucalyptus spp. | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Poaceae | Cymbopogon citratus | Ref. |
Plantae | Rutaceae | Citrus aurantifolia | Ref. |
Plantae | Rutaceae | Citrus aurantium | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus paradisi | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Rutaceae | Citrus sp. | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
- | - | Caffea sp. | Ref. |
- | - | Chamaecyparis | Ref. |
- | - | Citrus | Ref. |
- | - | Eucalyptus | Ref. |
- | - | Juniperus | Ref. |
|
|
zoom in
Organism | Thymus maroccanus | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|