Name |
beta-Phellandrene beta-Phellendrene (+/-)-beta-Phellandrene |
Formula |
C10H16 |
Mw |
136.12520051 |
CAS RN |
555-10-2 |
C_ID |
C00010872
,
|
InChIKey |
LFJQCDVYDGGFCH-UHFFFAOYNA-N |
InChICode |
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,6,8,10H,3,5,7H2,1-2H3/t10-/m1/s1 |
SMILES |
C1=C[C@H](CCC1=C)C(C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Anacardiaceae | Schinus terebinthus | Ref. |
Plantae | Annonaceae | Annona squamosa | Ref. |
Plantae | Annonaceae | Monodora myristica | Ref. |
Plantae | Annonaceae | Xylopia aethiopica | Ref. |
Plantae | Annonaceae | Xylopia parviflora | Ref. |
Plantae | Apiaceae | Angelica dahurica | Ref. |
Plantae | Apiaceae | Angelica sinensis | Ref. |
Plantae | Apiaceae | Angelica spp. | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Apiaceae | Petroselinum crispum | Ref. |
Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
Plantae | Asteraceae | Artemisia grandis | Ref. |
Plantae | Asteraceae | Chamaemelum nobile | Ref. |
Plantae | Asteraceae | Helianthus annuus | Ref. |
Plantae | Asteraceae | Phagnalon sordidum | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Asteraceae | Santolina corsica Jordan et Fourr | Ref. |
Plantae | Asteraceae | Senecio vulgaris | Ref. |
Plantae | Canellaceae | Canella winterana | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Cistaceae | Cistus albidus | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L. | Ref. |
Plantae | Fagaceae | Quercus coccifera | Ref. |
Plantae | Geraniaceae | Pelargonium graveolens | Ref. |
Plantae | Illiciaceae | Illicium anisatum | Ref. |
Plantae | Labiatae | Clinopodium nepeta | Ref. |
Plantae | Labiatae | Lavandula angustifolia | Ref. |
Plantae | Labiatae | Lavandula spp. | Ref. |
Plantae | Labiatae | Lavandula stoechas | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Labiatae | Thymus eriocalyx | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Labiatae | Thymus X-porlock | Ref. |
Plantae | Labiatae | Trichostema lanceolatum | Ref. |
Plantae | Lauraceae | Cinnamomum camphora | Ref. |
Plantae | Malvaceae | Gossypium sturtianum var.nandewarence | Ref. |
Plantae | Myrtaceae | Eucalyptus globulus | Ref. |
Plantae | Myrtaceae | Eucalyptus spp. | Ref. |
Plantae | Myrtaceae | Myrtus communis | Ref. |
Plantae | Oleaceae | Forsythia suspensa | Ref. |
Plantae | Pinaceae | Cedrus libani | Ref. |
Plantae | Pinaceae | Larix sibirica | Ref. |
Plantae | Pinaceae | Picea ajanensis | Ref. |
Plantae | Pinaceae | Picea obovata | Ref. |
Plantae | Pinaceae | Picea schrenkiana | Ref. |
Plantae | Pinaceae | Pinus halepensis | Ref. |
Plantae | Pinaceae | Pinus kesiya | Ref. |
Plantae | Pinaceae | Pinus mugo subsp. Mugo | Ref. |
Plantae | Pinaceae | Pinus sibirica L. | Ref. |
Plantae | Pinaceae | Pinus spp. | Ref. |
Plantae | Pinaceae | Pinus sylvestris L. | Ref. |
Plantae | Pinaceae | Pinus taeda | Ref. |
Plantae | Piperaceae | Piper arboreum | Ref. |
Plantae | Piperaceae | Piper fimbriulatum | Ref. |
Plantae | Piperaceae | Piper nigrum | Ref. |
Plantae | Plagiochilaceae | Plagiochila standleyi | Ref. |
Plantae | Poaceae | Cymbopogon flexuosus | Ref. |
Plantae | Rutaceae | Atalantia guillauminii | Ref. |
Plantae | Rutaceae | Citrus aurantium | Ref. |
Plantae | Rutaceae | Citrus grandis | Ref. |
Plantae | Rutaceae | Citrus latifolia | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus medica | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Rutaceae | Citrus sinki x Poncirus trifoliata | Ref. |
Plantae | Rutaceae | Clausena excavata | Ref. |
Plantae | Rutaceae | Poncirus trifoliate x Citrus sinensis | Ref. |
Plantae | Rutaceae | Poncirus trioliata | Ref. |
Plantae | Rutaceae | Zanthoxylum armatum | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis | Ref. |
Plantae | Zingiberaceae | Curcuma amada | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Curcuma longa | Ref. |
Plantae | Zingiberaceae | Curcuma mangga | Ref. |
Plantae | Zingiberaceae | Kaempferia galanga | Ref. |
Plantae | Zingiberaceae | Zingiber cassumunar Roxb. | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
- | - | Angelica | Ref. |
- | - | Eucalyptus | Ref. |
- | - | Lavandula | Ref. |
- | - | Mentha | Ref. |
- | - | Trachyspermum roxburghianum | Ref. |
|
|
zoom in
Organism | Curcuma longa | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|