Name |
(+)-Limonene (+)-(R)-limonene D-Limonene (+)-S-Carvone d-(+)-Limonene |
Formula |
C10H16 |
Mw |
136.12520051 |
CAS RN |
5989-27-5 |
C_ID |
C00010868
,
|
InChIKey |
XMGQYMWWDOXHJM-UEQNJFAPNA-N |
InChICode |
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3/t10-/m0/s1 |
SMILES |
C1=C(CC[C@H](C1)C(=C)C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Apiaceae | Anethum graveolens | Ref. |
Plantae | Apiaceae | Anethum spp. | Ref. |
Plantae | Apiaceae | Bupleurum chinense | Ref. |
Plantae | Apiaceae | Carum carvi L. | Ref. |
Plantae | Apiaceae | Coriandrum sativum | Ref. |
Plantae | Apiaceae | Cryptotaenia japonica | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Apiaceae | Notopterygium forbesii | Ref. |
Plantae | Apiaceae | Notopterygium incisum | Ref. |
Plantae | Aristolochiaceae | Asarum heterotropoides var.mandshuricum | Ref. |
Plantae | Aristolochiaceae | Asarum sieboldii | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Artemisia capillaris | Ref. |
Plantae | Asteraceae | Echinops grijsii | Ref. |
Plantae | Burseraceae | Boswellia carterii | Ref. |
Plantae | Burseraceae | Commiphora mukul | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Ericaceae | Rhododendron anthopogonoides | Ref. |
Plantae | Fabaceae | Colophospermum mopane | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Geraniaceae | Pelargonium graveolens | Ref. |
Plantae | Hamamelidaceae | Liquidambar formosana | Ref. |
Plantae | Labiatae | Agastache rugosus | Ref. |
Plantae | Labiatae | Clinopodium nepeta | Ref. |
Plantae | Labiatae | Mentha haplocalyx | Ref. |
Plantae | Labiatae | Mentha piperita | Ref. |
Plantae | Labiatae | Mosla dianthera | Ref. |
Plantae | Labiatae | Ocimum americanum | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Ocimum gratissimum | Ref. |
Plantae | Labiatae | Ocimum kilimandscharicim | Ref. |
Plantae | Labiatae | Ocimum sanctum | Ref. |
Plantae | Labiatae | Ocimum tenuiflorum | Ref. |
Plantae | Labiatae | Perilla frutescens var.acuta | Ref. |
Plantae | Labiatae | Perilla frutescens var.crispa | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Schizonepeta tenuifolia | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Lamiaceae | Rabdosia rubescens | Ref. |
Plantae | Lauraceae | Cinnamomum camphora | Ref. |
Plantae | Magnoliaceae | Magnolia officinalis | Ref. |
Plantae | Myrtaceae | Eucalyptus staigeriana | Ref. |
Plantae | Oleaceae | Forsythia suspensa | Ref. |
Plantae | Pandanaceae | Pandanus tectorius | Ref. |
Plantae | Pinaceae | Abies alba | Ref. |
Plantae | Pinaceae | Pinus banksiana | Ref. |
Plantae | Pinaceae | Pinus bungeana | Ref. |
Plantae | Pinaceae | Pinus contorta var. latifolia | Ref. |
Plantae | Pinaceae | Pinus koraiensis | Ref. |
Plantae | Pinaceae | Pinus taeda | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Rutaceae | Atalantia guillauminii | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus medica | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Rutaceae | Evodia rutaecarpa | Ref. |
Plantae | Rutaceae | Murraya paniculata | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
Plantae | Saururaceae | Houttuynia emeiensis | Ref. |
Plantae | Schisandraceae | Schisandra chinensis | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana jatamansii | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis var.latifolia | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
- | - | Baeckea frutescens | Ref. |
- | - | Pelargonicum graveolens | Ref. |
|
|
zoom in
Organism | Commiphora mukul | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|