Name |
6,8-Diprenylgenistein 5,7,4'-Trihydroxy-6,8-diprenylisoflavone 8-(gamma,gamma-Dimethylallyl)wighteone |
Formula |
C25H26O5 |
Mw |
406.17802394 |
CAS RN |
51225-28-6 |
C_ID |
C00009516
,
|
InChIKey |
UCHYSPNEUSDFQR-UHFFFAOYSA-N |
InChICode |
InChI=1S/C25H26O5/c1-14(2)5-11-18-22(27)19(12-6-15(3)4)25-21(23(18)28)24(29)20(13-30-25)16-7-9-17(26)10-8-16/h5-10,13,26-28H,11-12H2,1-4H3 |
SMILES |
c1(c(c(c2c(c1CC=C(C)C)occ(c2=O)c1ccc(cc1)O)O)CC=C(C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Fabaceae | Derris scandens | Ref. |
Plantae | Fabaceae | Erythrina senegalensis | Ref. |
Plantae | Fabaceae | Erythrina sigmoidea | Ref. |
Plantae | Fabaceae | Erythrina variegata | Ref. |
Plantae | Fabaceae | Erythrina vogelii | Ref. |
Plantae | Fabaceae | Euchresta horsfieldii | Ref. |
Plantae | Fabaceae | Euchresta japonica | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Glycyrrhiza inflata | Ref. |
Plantae | Fabaceae | Glycyrrhiza uralensis | Ref. |
Plantae | Fabaceae | Lupinus pilosus | Ref. |
Plantae | Fabaceae | Millettia pachycarpa | Ref. |
Plantae | Moraceae | Cudrania tricuspidata | Ref. |
|
|
zoom in
Organism | Millettia pachycarpa | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Singhal,Phytochem.,19,(1980),929 |
---|
|