Name |
Glycitein 7,4'-Dihydroxy-6-methoxyisoflavone |
Formula |
C16H12O5 |
Mw |
284.06847349 |
CAS RN |
40957-83-3 |
C_ID |
C00009392
,
|
InChIKey |
DXYUAIFZCFRPTH-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O5/c1-20-15-6-11-14(7-13(15)18)21-8-12(16(11)19)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
SMILES |
COc1cc2c(=O)c(-c3ccc(O)cc3)coc2cc1O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Annona muricata | Ref. |
Plantae | Apiaceae | Bupleurum scorzonerifolium | Ref. |
Plantae | Asphodelaceae | Aloe vera | Ref. |
Plantae | Convolvulaceae | Erycibe expansa | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Erythroxylaceae | Erythroxylum ulei | Ref. |
Plantae | Fabaceae | Centrosema haitiense | Ref. |
Plantae | Fabaceae | Centrosema pubescens | Ref. |
Plantae | Fabaceae | Cicer arietinum | Ref. |
Plantae | Fabaceae | Dalbergia frutescens | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Maackia amurensis | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Mildbraediodendron excelsum | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Psoralea corylifolia | Ref. |
Plantae | Fabaceae | Pterocarpus marsupium | Ref. |
Plantae | Fabaceae | Pueraria lobata | Ref. |
Plantae | Fabaceae | Pueraria thunbergiana | Ref. |
Plantae | Fabaceae | Pueraria tuberosa | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Fabaceae | Trifolium repens | Ref. |
Plantae | Fabaceae | Vigna radiata | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
- | - | Sarcolobus globosus | Ref. |
|
|
zoom in
Organism | Centrosema haitiense | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Markham,Z.Naturforsch.C.,35,(1980),919
Meegan,Phytochem.,14,(1975),2283 |
---|
|