Name |
Daidzein 7,4'-Dihydroxyisoflavone |
Formula |
C15H10O4 |
Mw |
254.05790881 |
CAS RN |
486-66-8 |
C_ID |
C00009380
,
|
InChIKey |
ZQSIJRDFPHDXIC-UHFFFAOYSA-N |
InChICode |
InChI=1S/C15H10O4/c16-10-3-1-9(2-4-10)13-8-19-14-7-11(17)5-6-12(14)15(13)18/h1-8,16-17H |
SMILES |
c1(ccc2c(c1)occ(c2=O)c1ccc(cc1)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
Bacteria | Streptomycetaceae | Streptomyces xanthophaeus MD865-C3 | Ref. |
Plantae | Annonaceae | Annona muricata | Ref. |
Plantae | Apiaceae | Bupleurum scorzonerifolium | Ref. |
Plantae | Asphodelaceae | Aloe vera | Ref. |
Plantae | Celastraceae | Tripterygium wilfordii | Ref. |
Plantae | Convolvulaceae | Erycibe expansa | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica oleracea | Ref. |
Plantae | Erythroxylaceae | Erythroxylum ulei | Ref. |
Plantae | Fabaceae | Albizia procera | Ref. |
Plantae | Fabaceae | Arachis hypogaea | Ref. |
Plantae | Fabaceae | Cajanus cajan | Ref. |
Plantae | Fabaceae | Cicer arietinum | Ref. |
Plantae | Fabaceae | Crotalaria assamica | Ref. |
Plantae | Fabaceae | Crotalaria pallida | Ref. |
Plantae | Fabaceae | Dalbergia ecastaphyllum | Ref. |
Plantae | Fabaceae | Dalbergia odorifera | Ref. |
Plantae | Fabaceae | Dalbergia stevensonii | Ref. |
Plantae | Fabaceae | Derris oblonga | Ref. |
Plantae | Fabaceae | Erythrina crista-galli | Ref. |
Plantae | Fabaceae | Erythrina indica | Ref. |
Plantae | Fabaceae | Erythrina latissima | Ref. |
Plantae | Fabaceae | Erythrina orientalis | Ref. |
Plantae | Fabaceae | Euchresta formosana | Ref. |
Plantae | Fabaceae | Genista corsica | Ref. |
Plantae | Fabaceae | Genista tinctoria | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Glycyrrhiza inflata | Ref. |
Plantae | Fabaceae | Glycyrrhiza uralensis | Ref. |
Plantae | Fabaceae | Lespedeza bicolor | Ref. |
Plantae | Fabaceae | Maackia amurensis | Ref. |
Plantae | Fabaceae | Medicago arabica | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Pericopsis angolensis Baker. | Ref. |
Plantae | Fabaceae | Pericopsis eleta | Ref. |
Plantae | Fabaceae | Pericopsis laxiflora Benth. | Ref. |
Plantae | Fabaceae | Pericopsis mooniana | Ref. |
Plantae | Fabaceae | Phaseolus coccineus | Ref. |
Plantae | Fabaceae | Phaseolus spp. | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Piptanthus nepalensis | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Psoralea corylifolia | Ref. |
Plantae | Fabaceae | Pterocarpus marsupium | Ref. |
Plantae | Fabaceae | Pueraria calycina | Ref. |
Plantae | Fabaceae | Pueraria candollei var. mirifica | Ref. |
Plantae | Fabaceae | Pueraria edulis | Ref. |
Plantae | Fabaceae | Pueraria lobata | Ref. |
Plantae | Fabaceae | Pueraria mirifica | Ref. |
Plantae | Fabaceae | Pueraria peduncularis | Ref. |
Plantae | Fabaceae | Pueraria Phaseoloides | Ref. |
Plantae | Fabaceae | Pueraria thunbergiana | Ref. |
Plantae | Fabaceae | Pueraria tuberosa | Ref. |
Plantae | Fabaceae | Retama raetam | Ref. |
Plantae | Fabaceae | Sophora flavescens | Ref. |
Plantae | Fabaceae | Sophora japonica | Ref. |
Plantae | Fabaceae | Sophora subprostrata | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Fabaceae | Trifolium repens | Ref. |
Plantae | Fabaceae | Trifolium riograndense | Ref. |
Plantae | Fabaceae | Ulex europaeus | Ref. |
Plantae | Fabaceae | Vigna radiata | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Iridaceae | Crocus sativus | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrine | Ref. |
Plantae | Moringaceae | Moringa stenopetala | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Podocarpaceae | Podocarpus amarus | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Taxaceae | Taxus fuana | Ref. |
Plantae | Taxaceae | Taxus yunnanensis | Ref. |
- | - | Leguminosae | Ref. |
- | - | Peuraria lobata | Ref. |
- | - | Peuraria lobata var.thomsonii | Ref. |
- | - | Peuraria omeinsis | Ref. |
- | - | Sarcolobus globosus | Ref. |
|
|
zoom in
Organism | Trifolium riograndense | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|