Name |
Procyanidin C1 [Epicatechin-(4beta->8)]2-epicatechin |
Formula |
C45H38O18 |
Mw |
866.20581441 |
CAS RN |
65085-09-8 |
C_ID |
C00009098
,
|
InChIKey |
MOJZMWJRUKIQGL-UZWUUNAJNA-N |
InChICode |
InChI=1S/C45H38O18/c46-18-10-27(54)33-32(11-18)61-42(16-2-5-21(48)25(52)8-16)39(59)37(33)35-29(56)14-30(57)36-38(40(60)43(63-45(35)36)17-3-6-22(49)26(53)9-17)34-28(55)13-23(50)19-12-31(58)41(62-44(19)34)15-1-4-20(47)24(51)7-15/h1-11,13-14,31,37-43,46-60H,12H2/t31-,37-,38-,39-,40-,41+,42-,43-/m1/s1 |
SMILES |
c12c([C@@H]([C@H]([C@H](O1)c1ccc(c(c1)O)O)O)c1c3c([C@H]([C@H]([C@H](O3)c3ccc(c(c3)O)O)O)c3c4c(C[C@H]([C@@H](O4)c4ccc(c(c4)O)O)O)c(cc3O)O)c(cc1O)O)c(cc(c2)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Aizoaceae | Nelia meyeri | Ref. |
Plantae | Betulaceae | Betula spp. | Ref. |
Plantae | Dioscoreaceae | Dioscorea cirrhosa | Ref. |
Plantae | Fabaceae | Campylotropis hirella | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Lauraceae | Cinnamomum cassia Blume. | Ref. |
Plantae | Lauraceae | Cinnamomum comphora | Ref. |
Plantae | Lauraceae | Cinnamomum obtusifolium Nees. | Ref. |
Plantae | Lauraceae | Cinnamomum zeylanicum | Ref. |
Plantae | Malvaceae | Theobroma cacao | Ref. |
Plantae | Pinaceae | Pinus taeda | Ref. |
Plantae | Pinaceae | Pseudotsuga menziesii | Ref. |
Plantae | Rhizophoraceae | Kandelia candel | Ref. |
Plantae | Rosaceae | Coleogyne ramosissima Torr. | Ref. |
Plantae | Rosaceae | Crataegus oxyacantha | Ref. |
Plantae | Rosaceae | Eriobotrya japonica | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rosaceae | Rhaphiolepis umbellata | Ref. |
Plantae | Rubiaceae | Cinchona succirubra | Ref. |
Plantae | Salicaceae | Salix daphnoides | Ref. |
Plantae | Sapindaceae | Aesculus hippocastanum | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Vitaceae | Vitis vinifera | Ref. |
|
|
zoom in
Organism | Rhaphiolepis umbellata | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Nonaka,J.Chem.Soc.Chem.Commun.,(1981),781
Hemingway,J.Chem.Soc.Perkin Trans.,1,(1982),1209 |
---|
|