Name |
Procyanidin B1 Epicatechin-(4beta->8)-catechin |
Formula |
C30H26O12 |
Mw |
578.1424263 |
CAS RN |
20315-25-7 |
C_ID |
C00009075
,
|
InChIKey |
XFZJEEAOWLFHDH-QYWHNURQNA-N |
InChICode |
InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26-,27-,28-,29-/m1/s1 |
SMILES |
c12c([C@@H]([C@H]([C@H](O1)c1ccc(c(c1)O)O)O)c1c3c(C[C@H]([C@H](O3)c3ccc(c(c3)O)O)O)c(cc1O)O)c(cc(c2)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Betulaceae | Betula pubescens | Ref. |
Plantae | Cistaceae | Cistus incanus | Ref. |
Plantae | Cupressaceae | Thujopsis dolobrata | Ref. |
Plantae | Dioscoreaceae | Dioscorea alata | Ref. |
Plantae | Dioscoreaceae | Dioscorea bulbifera | Ref. |
Plantae | Ericaceae | Pyrola incarnata | Ref. |
Plantae | Ericaceae | Rhododendron sp. | Ref. |
Plantae | Ericaceae | Vaccinium vitis-idaea | Ref. |
Plantae | Fabaceae | Campylotropis hirella | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Fabaceae | Vigna angularis | Ref. |
Plantae | Fagaceae | Quercus miyagii | Ref. |
Plantae | Illiciaceae | Illicium anisatum | Ref. |
Plantae | Lauraceae | Cinnamomum camphora | Ref. |
Plantae | Lauraceae | Cinnamomum cassia Blume. | Ref. |
Plantae | Lauraceae | Cinnamomum cirrhosa | Ref. |
Plantae | Lauraceae | Cinnamomum spp. | Ref. |
Plantae | Lauraceae | Persea gratissima | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Guazuma ulmifolia | Ref. |
Plantae | Malvaceae | Theobroma cacao | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Oxalidaceae | Averrhoa carambola L. | Ref. |
Plantae | Palmae | Areca catechu | Ref. |
Plantae | Pinaceae | Larix gmelini | Ref. |
Plantae | Pinaceae | Picea abies | Ref. |
Plantae | Polygonaceae | Rheum sp. | Ref. |
Plantae | Rosaceae | Coleogyne ramosissima Torr. | Ref. |
Plantae | Rosaceae | Crataegus monogyna | Ref. |
Plantae | Rosaceae | Crataegus spp. | Ref. |
Plantae | Rosaceae | Fragaria vesca | Ref. |
Plantae | Rosaceae | Malus spp. | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rosaceae | Pyrus spp. | Ref. |
Plantae | Rosaceae | Rubus spp. | Ref. |
Plantae | Rubiaceae | Uncaria gambir | Ref. |
Plantae | Rubiaceae | Uncaria sinensis | Ref. |
Plantae | Salicaceae | Salix daphnoides | Ref. |
Plantae | Sapindaceae | Aesculus hippocastanum | Ref. |
Plantae | Sapotaceae | Sideroxylon inerme L. | Ref. |
Plantae | Vitaceae | Vitis vinifera | Ref. |
|
|
zoom in
Organism | Salix daphnoides | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|