Name |
Procyanidin B3 Catechin-(4alpha->8)-catechin |
Formula |
C30H26O12 |
Mw |
578.1424263 |
CAS RN |
23567-23-9 |
C_ID |
C00009071
,
|
InChIKey |
XFZJEEAOWLFHDH-KJNMLZBZNA-N |
InChICode |
InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26-,27-,28-,29+/m0/s1 |
SMILES |
c12c([C@H]([C@@H]([C@H](O1)c1cc(c(cc1)O)O)O)c1c3c(C[C@@H]([C@@H](O3)c3cc(c(cc3)O)O)O)c(cc1O)O)c(cc(c2)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Betulaceae | Betula pubescens | Ref. |
Plantae | Dioscoreaceae | Dioscorea alata | Ref. |
Plantae | Ericaceae | Calluna vulgaris | Ref. |
Plantae | Ericaceae | Pyrola incarnata | Ref. |
Plantae | Ericaceae | Vaccinium vitis-idaea | Ref. |
Plantae | Fabaceae | Arachis hypogaea | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Fagaceae | Quercus miyagii | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Palmae | Areca catechu | Ref. |
Plantae | Pinaceae | Larix gmelini | Ref. |
Plantae | Pinaceae | Picea abies | Ref. |
Plantae | Rosaceae | Coleogyne ramosissima Torr. | Ref. |
Plantae | Rosaceae | Fragaria spp. | Ref. |
Plantae | Rosaceae | Potentilla viscosa | Ref. |
Plantae | Rosaceae | Rosa cymosa | Ref. |
Plantae | Rosaceae | Rosa henryi | Ref. |
Plantae | Rosaceae | Rosa laevigata | Ref. |
Plantae | Rosaceae | Rubus spp. | Ref. |
Plantae | Rubiaceae | Uncaria gambir | Ref. |
Plantae | Salicaceae | Populus canescens | Ref. |
Plantae | Salicaceae | Salix caprea | Ref. |
Plantae | Salicaceae | Salix daphnoides | Ref. |
Plantae | Sapindaceae | Aesculus hippocastanum | Ref. |
Plantae | Saxifragaceae | Bergenia purpurascens | Ref. |
Plantae | Theaceae | Camellia japonica | Ref. |
Plantae | Theaceae | Camellia sinensis var.assamica | Ref. |
Plantae | Vitaceae | Vitis vinifera | Ref. |
|
|
zoom in
Organism | Rubus spp. | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Thompson,J.Chem.Soc.Perkin Trans.,1,(1972),1387 |
---|
|