Name |
Isobavachin |
Formula |
C20H20O4 |
Mw |
324.13615913 |
CAS RN |
31524-62-6 |
C_ID |
C00008197
, 
|
InChIKey |
KYFBXCHUXFKMGQ-UHFFFAOYNA-N |
InChICode |
InChI=1S/C20H20O4/c1-12(2)3-8-15-17(22)10-9-16-18(23)11-19(24-20(15)16)13-4-6-14(21)7-5-13/h3-7,9-10,19,21-22H,8,11H2,1-2H3/t19-/m0/s1 |
SMILES |
c1(ccc2c(c1CC=C(C)C)O[C@@H](CC2=O)c1ccc(cc1)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Angelica keiskei  | Ref. |
Plantae | Cannabaceae | Humulus lupulus  | Ref. |
Plantae | Euphorbiaceae | Macaranga conifera | Ref. |
Plantae | Fabaceae | Cullen corylifolium | Ref. |
Plantae | Fabaceae | Erythrina variegata  | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
Plantae | Fabaceae | Lespedeza cyrtobotrya | Ref. |
Plantae | Fabaceae | Psoralea corylifolia  | Ref. |
Plantae | Fabaceae | Sophora alopecuroides | Ref. |
Plantae | Fabaceae | Sophora flavescens  | Ref. |
Plantae | Fabaceae | Sophora moorcroftiana  | Ref. |
Plantae | Fabaceae | Sophora tomentosa  | Ref. |
Plantae | Moraceae | Brosimum acutifolium  | Ref. |
Plantae | Moraceae | Cudrania cochinchinensis  | Ref. |
|
|
zoom in
Organism | Sophora tomentosa | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 294,Flavanones and dihydroflavonols
Bhalla,Tetrahedron Lett.,(1968),2401 |
---|
|