Name |
beta-Sesquiphellandrene |
Formula |
C15H24 |
Mw |
204.18780077 |
CAS RN |
20307-83-9 |
C_ID |
C00007630
, 
|
InChIKey |
PHWISBHSBNDZDX-PVRQQBJHNA-N |
InChICode |
InChI=1S/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8,10,14-15H,3,5,7,9,11H2,1-2,4H3/t14-,15+/m0/s1 |
SMILES |
C1=C[C@H](CCC1=C)[C@H](CCC=C(C)C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acoraceae | Acorus calanus L. | Ref. |
Plantae | Anacardiaceae | Mangifera indica  | Ref. |
Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
Plantae | Asteraceae | Ageratina conyzoides | Ref. |
Plantae | Asteraceae | Eupatorium adenophorum  | Ref. |
Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
Plantae | Calypogeia | Calypogeia suecica | Ref. |
Plantae | Cistaceae | Cistus albidus | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Fabaceae | Trifolium repens L.  | Ref. |
Plantae | Labiatae | Ocimum basilicum  | Ref. |
Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
Plantae | Lauraceae | Litsea cubeba  | Ref. |
Plantae | Pinaceae | Pinus halepensis  | Ref. |
Plantae | Polygonaceae | Persicaria minor | Ref. |
Plantae | Rutaceae | Citrus paradisi  | Ref. |
Plantae | Rutaceae | Citrus reticulata  | Ref. |
Plantae | Rutaceae | Clausena lansium  | Ref. |
Plantae | Rutaceae | Murraya paniculata  | Ref. |
Plantae | Rutaceae | Poncirus trifoliate x Citrus sinensis | Ref. |
Plantae | Solanaceae | Solanum tuberosum  | Ref. |
Plantae | Zingiberaceae | Curcuma aeruginosa  | Ref. |
Plantae | Zingiberaceae | Curcuma domestica  | Ref. |
Plantae | Zingiberaceae | Curcuma longa  | Ref. |
Plantae | Zingiberaceae | Curcuma phaeocaulis  | Ref. |
Plantae | Zingiberaceae | Curcuma wenyujin  | Ref. |
Plantae | Zingiberaceae | Zingiber cassumunar Roxb.  | Ref. |
Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
Organism | Ageratina conyzoides | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|