Name |
Obtusifoliol |
Formula |
C30H50O |
Mw |
426.38616622 |
CAS RN |
16910-32-0 |
C_ID |
C00007368
,
|
InChIKey |
MMNYKQIDRZNIKT-AVABUNCKNA-N |
InChICode |
InChI=1S/C30H50O/c1-19(2)20(3)9-10-21(4)23-13-17-30(8)26-12-11-24-22(5)27(31)15-16-28(24,6)25(26)14-18-29(23,30)7/h19,21-24,27,31H,3,9-18H2,1-2,4-8H3/t21-,22+,23-,24+,27+,28+,29-,30+/m1/s1 |
SMILES |
[C@@H]1([C@H]2[C@](CC[C@@H]1O)(C1=C(CC2)[C@]2([C@](CC1)([C@H](CC2)[C@H](C)CCC(=C)C(C)C)C)C)C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Fungi | Mucoraceae | Mucor pusillus | Ref. |
Fungi | Saccharomycetaceae | Candida albicans | Ref. |
Fungi | Saccharomycetaceae | Saccharomyces cerevisiae | Ref. |
Fungi | Sclerotiniaceae | Monilinia fructigena | Ref. |
Plantae | Betulaceae | Corylus avellana | Ref. |
Plantae | Betulaceae | Corylus maxima | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Euphorbiaceae | Euphorbia guyoniana | Ref. |
Plantae | Euphorbiaceae | Euphorbia officinarum | Ref. |
Plantae | Euphorbiaceae | Euphorbia peplus | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Geraniaceae | Pelargonium hortorum | Ref. |
Plantae | Labiatae | Sideritis discolor | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Ranunculaceae | Nigella sativa | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Datura metel | Ref. |
Plantae | Solanaceae | Lycium chinense | Ref. |
Plantae | Solanaceae | Lycopersicon esculentum | Ref. |
Plantae | Solanaceae | Nicotiana benthamiana | Ref. |
Plantae | Solanaceae | Physalis alkekengi var. francheti | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Solanaceae | Solanum melongena | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
- | - | Leptoshaeria maculans | Ref. |
- | - | Ustilago maydis | Ref. |
|
|
zoom in
Organism | Saccharomyces cerevisiae | Reference | Nes,Analysis of Sterols and Other Biologically Significant Steroids
Academic Press Inc.,New York,Ny,pp.341(1989)
Ragsdale,Biochim.Biophys.Acta,380,(1975),81-86
Trocha,Biochem.Biophys.Res.Commun.,59,(1974),666-671 |
---|
|