Name |
Cycloeucalenol |
Formula |
C30H50O |
Mw |
426.38616622 |
CAS RN |
469-39-6 |
C_ID |
C00007367
,
|
InChIKey |
HUNLTIZKNQDZEI-ZAKOVJSENA-N |
InChICode |
InChI=1S/C30H50O/c1-19(2)20(3)8-9-21(4)23-12-14-28(7)26-11-10-24-22(5)25(31)13-15-29(24)18-30(26,29)17-16-27(23,28)6/h19,21-26,31H,3,8-18H2,1-2,4-7H3/t21-,22+,23-,24+,25+,26+,27-,28+,29-,30+/m1/s1 |
SMILES |
[C@@H]1([C@H]2[C@]3(CC[C@@H]1O)[C@]1([C@@H](CC2)[C@]2([C@@](CC1)(C)[C@H](CC2)[C@H](C)CCC(=C)C(C)C)C)C3)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cucurbitaceae | Trichosanthes palmata | Ref. |
Plantae | Euphorbiaceae | Euphorbia guyoniana | Ref. |
Plantae | Labiatae | Sideritis discolor | Ref. |
Plantae | Menispermaceae | Tinospora crispa | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Ranunculaceae | Nigella sativa | Ref. |
Plantae | Solanaceae | Nicotiana benthamiana | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
|
|
zoom in
Organism | Tinospora crispa | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|