Name |
alpha-Linolenic acid Linolenic acid (Z,Z,Z)-Octadeca-9,12,15-trienoic acid |
Formula |
C18H30O2 |
Mw |
278.2245802 |
CAS RN |
463-40-1 |
C_ID |
C00007247
|
InChIKey |
DTOSIQBPPRVQHS-PDBXOOCHSA-N |
InChICode |
InChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9- |
SMILES |
OC(CCCCCCC/C=CC/C=CC/C=CCC)=O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
Fungi | Agaricaceae | Psalliota bispora | Ref. |
Fungi | Clavicipitaceae | Cordyceps sinensis  | Ref. |
Plantae | Alliaceae | Allium hirtifolium | Ref. |
Plantae | Amaranthaceae | Celosia cristada | Ref. |
Plantae | Anacardiaceae | Mangifera indica  | Ref. |
Plantae | Annonaceae | Annona squamosa  | Ref. |
Plantae | Apiaceae | Apium graveolens  | Ref. |
Plantae | Apiaceae | Bupleurum chinense | Ref. |
Plantae | Araliaceae | Acanthopanax gracilistylus  | Ref. |
Plantae | Asphodelaceae | Aloe vera var.chinensis  | Ref. |
Plantae | Asteraceae | Carthamus tinctorius  | Ref. |
Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
Plantae | Asteraceae | Matricaria recutita  | Ref. |
Plantae | Asteraceae | Silybum marianum  | Ref. |
Plantae | Berberidaceae | Epimedium brevicornum  | Ref. |
Plantae | Boraginaceae | Echium auberianum | Ref. |
Plantae | Boraginaceae | Echium boissieri | Ref. |
Plantae | Boraginaceae | Echium gentianoides | Ref. |
Plantae | Boraginaceae | Echium giganteum | Ref. |
Plantae | Boraginaceae | Echium lusitanicum | Ref. |
Plantae | Boraginaceae | Echium pitardii | Ref. |
Plantae | Boraginaceae | Echium plantagineum  | Ref. |
Plantae | Boraginaceae | Echium sabulicola | Ref. |
Plantae | Boraginaceae | Echium strictum | Ref. |
Plantae | Boraginaceae | Echium vulgare  | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum calaba | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum inophyllum  | Ref. |
Plantae | Cannabaceae | Humulus lupulus  | Ref. |
Plantae | Caricaceae | Carica papaya  | Ref. |
Plantae | Caryophyllaceae | Drymaria cordata  | Ref. |
Plantae | Chlorellaceae | Chlorella vulgaris | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica rapa  | Ref. |
Plantae | Cruciferae | Lepidium meyenii Maca  | Ref. |
Plantae | Cruciferae | Raphanus sativus  | Ref. |
Plantae | Cucurbitaceae | Trichosanthes kirilowii  | Ref. |
Plantae | Cucurbitaceae | Trichosanthes rosthornii  | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Elaeagnaceae | Hippophae rhamnoides  | Ref. |
Plantae | Euphorbiaceae | Anabaena flos-aquae | Ref. |
Plantae | Euphorbiaceae | Croton tiglium  | Ref. |
Plantae | Fabaceae | Astragalus mongholicus | Ref. |
Plantae | Fabaceae | Clitoria ternata | Ref. |
Plantae | Fabaceae | Glycine max  | Ref. |
Plantae | Fabaceae | Mucuna puriens | Ref. |
Plantae | Fabaceae | Psoralea corylifolia  | Ref. |
Plantae | Fabaceae | Vicia faba  | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
Plantae | Labiatae | Perilla frutescens var.arguta  | Ref. |
Plantae | Labiatae | Thymus capitatus  | Ref. |
Plantae | Linaceae | Linum usitatissimum  | Ref. |
Plantae | Loranthaceae | Scurrula atropurpurea | Ref. |
Plantae | Lythraceae | Punica granatum  | Ref. |
Plantae | Malvaceae | Durio zibethinus  | Ref. |
Plantae | Malvaceae | Tilia cordata Mill.  | Ref. |
Plantae | Meliaceae | Azadirachta indica  | Ref. |
Plantae | Myrtaceae | Myrtus communis  | Ref. |
Plantae | Nymphaeaceae | Nymphaea alba  | Ref. |
Plantae | Oleaceae | Jasminum auriculatum  | Ref. |
Plantae | Oxalidaceae | Averrhoa carambola  | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Poaceae | Oryza sativa  | Ref. |
Plantae | Poaceae | Triticum aestivum  | Ref. |
Plantae | Ranunculaceae | Nigella sativa L  | Ref. |
Plantae | Rosaceae | Crataegus pinnatifida  | Ref. |
Plantae | Rosaceae | Potentilla asiatica | Ref. |
Plantae | Rosaceae | Potentilla desertorum | Ref. |
Plantae | Rosaceae | Potentilla orientalis | Ref. |
Plantae | Rosaceae | Prunus armeniaca  | Ref. |
Plantae | Rosaceae | Prunus avium  | Ref. |
Plantae | Rutaceae | Aegle marmelos  | Ref. |
Plantae | Solanaceae | Lycium chinense  | Ref. |
Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
Plantae | Solanaceae | Solanum tuberosum  | Ref. |
Plantae | Solanaceae | Withania somnifera  | Ref. |
Plantae | Typhaceae | Typha domingensis P.  | Ref. |
Plantae | Zingiberaceae | Alpinia oxyphylla  | Ref. |
Plantae | Zingiberaceae | Curcuma longa  | Ref. |
- | - | FOOD SAKE | Ref. |
- | - | Poterium polygamum | Ref. |
- | - | Scurrura atropurpurea | Ref. |
|
|
zoom in
Organism | Prunus armeniaca | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
OHASHI, et al., Chem Pharm Bull, 51, (2003), 343.
Morikawa, et al., Journal of Natural Products, 65, (2002), 1468.
Park, et al., Planta Med, 69, (2003), 459 |
---|
|