Name |
alpha-Linolenic acid Linolenic acid (Z,Z,Z)-Octadeca-9,12,15-trienoic acid |
Formula |
C18H30O2 |
Mw |
278.2245802 |
CAS RN |
463-40-1 |
C_ID |
C00007247
|
InChIKey |
DTOSIQBPPRVQHS-PDBXOOCHSA-N |
InChICode |
InChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9- |
SMILES |
OC(CCCCCCC/C=CC/C=CC/C=CCC)=O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
Fungi | Agaricaceae | Psalliota bispora | Ref. |
Fungi | Clavicipitaceae | Cordyceps sinensis | Ref. |
Plantae | Alliaceae | Allium hirtifolium | Ref. |
Plantae | Amaranthaceae | Celosia cristada | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Annona squamosa | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Bupleurum chinense | Ref. |
Plantae | Araliaceae | Acanthopanax gracilistylus | Ref. |
Plantae | Asphodelaceae | Aloe vera var.chinensis | Ref. |
Plantae | Asteraceae | Carthamus tinctorius | Ref. |
Plantae | Asteraceae | Chamaemelum nobile | Ref. |
Plantae | Asteraceae | Matricaria recutita | Ref. |
Plantae | Asteraceae | Silybum marianum | Ref. |
Plantae | Berberidaceae | Epimedium brevicornum | Ref. |
Plantae | Boraginaceae | Echium auberianum | Ref. |
Plantae | Boraginaceae | Echium boissieri | Ref. |
Plantae | Boraginaceae | Echium gentianoides | Ref. |
Plantae | Boraginaceae | Echium giganteum | Ref. |
Plantae | Boraginaceae | Echium lusitanicum | Ref. |
Plantae | Boraginaceae | Echium pitardii | Ref. |
Plantae | Boraginaceae | Echium plantagineum | Ref. |
Plantae | Boraginaceae | Echium sabulicola | Ref. |
Plantae | Boraginaceae | Echium strictum | Ref. |
Plantae | Boraginaceae | Echium vulgare | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum calaba | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum inophyllum | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Caryophyllaceae | Drymaria cordata | Ref. |
Plantae | Chlorellaceae | Chlorella vulgaris | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica rapa | Ref. |
Plantae | Cruciferae | Lepidium meyenii Maca | Ref. |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Cucurbitaceae | Trichosanthes kirilowii | Ref. |
Plantae | Cucurbitaceae | Trichosanthes rosthornii | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Elaeagnaceae | Hippophae rhamnoides | Ref. |
Plantae | Euphorbiaceae | Anabaena flos-aquae | Ref. |
Plantae | Euphorbiaceae | Croton tiglium | Ref. |
Plantae | Fabaceae | Astragalus mongholicus | Ref. |
Plantae | Fabaceae | Clitoria ternata | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Mucuna puriens | Ref. |
Plantae | Fabaceae | Psoralea corylifolia | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Labiatae | Perilla frutescens var.arguta | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Linaceae | Linum usitatissimum | Ref. |
Plantae | Loranthaceae | Scurrula atropurpurea | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Durio zibethinus | Ref. |
Plantae | Malvaceae | Tilia cordata Mill. | Ref. |
Plantae | Meliaceae | Azadirachta indica | Ref. |
Plantae | Myrtaceae | Myrtus communis | Ref. |
Plantae | Nymphaeaceae | Nymphaea alba | Ref. |
Plantae | Oleaceae | Jasminum auriculatum | Ref. |
Plantae | Oxalidaceae | Averrhoa carambola | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Ranunculaceae | Nigella sativa L | Ref. |
Plantae | Rosaceae | Crataegus pinnatifida | Ref. |
Plantae | Rosaceae | Potentilla asiatica | Ref. |
Plantae | Rosaceae | Potentilla desertorum | Ref. |
Plantae | Rosaceae | Potentilla orientalis | Ref. |
Plantae | Rosaceae | Prunus armeniaca | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rutaceae | Aegle marmelos | Ref. |
Plantae | Solanaceae | Lycium chinense | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Solanaceae | Withania somnifera | Ref. |
Plantae | Typhaceae | Typha domingensis P. | Ref. |
Plantae | Zingiberaceae | Alpinia oxyphylla | Ref. |
Plantae | Zingiberaceae | Curcuma longa | Ref. |
- | - | FOOD SAKE | Ref. |
- | - | Poterium polygamum | Ref. |
- | - | Scurrura atropurpurea | Ref. |
|
|
zoom in
Organism | Mucuna puriens | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|