Name |
Cyanidin 3-(6''-malonylglucoside) Cyanidin-3-O-(6-O-malonyl-beta-D-glucopyranoside) |
Formula |
C24H23O14 |
Mw |
535.10878045 |
CAS RN |
94977-38-5 |
C_ID |
C00006796
,
|
InChIKey |
ROQLTZUOXIQBDO-AOJYJDMDNA-O |
InChICode |
InChI=1S/C24H22O14/c25-10-4-13(27)11-6-16(23(36-15(11)5-10)9-1-2-12(26)14(28)3-9)37-24-22(34)21(33)20(32)17(38-24)8-35-19(31)7-18(29)30/h1-6,17,20-22,24,32-34H,7-8H2,(H4-,25,26,27,28,29,30)/p+1/t17-,20-,21-,22-,24-/m1/s1 |
SMILES |
O=C(O)CC(=O)OCC1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2ccc(O)c(O)c2)C(O)C(O)[C@@H]1O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Alliaceae | Allium cepa | Ref. |
Plantae | Alliaceae | Allium sativum | Ref. |
Plantae | Alliaceae | Allium schoenoprasum | Ref. |
Plantae | Alliaceae | Allium victorialis | Ref. |
Plantae | Alstroemeriaceae | Alstroemeria spp. | Ref. |
Plantae | Asteraceae | Bellis perennis | Ref. |
Plantae | Asteraceae | Centaurea cyanus | Ref. |
Plantae | Asteraceae | Chrysanthemum x morifolium | Ref. |
Plantae | Asteraceae | Cichorium intybus | Ref. |
Plantae | Asteraceae | Lactuca sativa | Ref. |
Plantae | Calochortaceae | Tricyrtis formosana | Ref. |
Plantae | Caryophyllaceae | Dianthus caryophyllus | Ref. |
Plantae | Caryophyllaceae | Dianthus deltoides | Ref. |
Plantae | Fabaceae | Lupinus spp. | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Malvaceae | Hibiscus syriacus | Ref. |
Plantae | Orchidaceae | Dracula chimaera | Ref. |
Plantae | Passifloraceae | Passiflora edulis | Ref. |
Plantae | Passifloraceae | Passiflora suberosa | Ref. |
Plantae | Poaceae | Alopecurus spp. | Ref. |
Plantae | Poaceae | Anthoxanthum spp. | Ref. |
Plantae | Poaceae | Avenula spp. | Ref. |
Plantae | Poaceae | Bothriochloa spp. | Ref. |
Plantae | Poaceae | Dactylis spp. | Ref. |
Plantae | Poaceae | Deschampsia spp. | Ref. |
Plantae | Poaceae | Elymus spp. | Ref. |
Plantae | Poaceae | Festuca spp. | Ref. |
Plantae | Poaceae | Hordeum spp. | Ref. |
Plantae | Poaceae | Miscanthus spp. | Ref. |
Plantae | Poaceae | Molinia spp. | Ref. |
Plantae | Poaceae | Oryza spp. | Ref. |
Plantae | Poaceae | Phalaris arundinacea | Ref. |
Plantae | Poaceae | Phalaris spp. | Ref. |
Plantae | Poaceae | Phleum spp. | Ref. |
Plantae | Poaceae | Phragmites australis | Ref. |
Plantae | Poaceae | Poa spp. | Ref. |
Plantae | Poaceae | Sinarundinaria spp. | Ref. |
Plantae | Poaceae | Zea mays | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Verbenaceae | Verbena x hybrida | Ref. |
|
|
zoom in
Organism | Dianthus caryophyllus | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Bridle,Phytochem.,23,(1984),2968 |
---|
|